|
|
| | O-QUARTERPHENYL Basic information |
| | O-QUARTERPHENYL Chemical Properties |
| Melting point | 211-214 °C(lit.) | | Boiling point | 454℃ | | density | 1.358 | | Fp | 172℃ | | storage temp. | 2-8°C | | form | powder to crystal | | color | Light yellow to Yellow to Orange | | semiconductor properties | P-type (mobility=1.2×10-3cm2/V·s) | | InChI | 1S/C16H10S4/c1-3-11(17-9-1)13-5-7-15(19-13)16-8-6-14(20-16)12-4-2-10-18-12/h1-10H | | InChIKey | FXEJOIFDICYSSO-UHFFFAOYSA-N | | SMILES | c1csc(c1)-c2ccc(s2)-c3ccc(s3)-c4cccs4 |
| WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids |
| | O-QUARTERPHENYL Usage And Synthesis |
| | O-QUARTERPHENYL Preparation Products And Raw materials |
|