- Fmoc-L-Arg-OH
-
- $0.00/ kg
-
2026-01-23
- CAS:91000-69-0
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
- Fmoc-Arg-OH
-
- $29.00 / 1g
-
2026-01-15
- CAS:91000-69-0
- Min. Order:
- Purity: 100.00%
- Supply Ability: 10g
- Fmoc-Arg-OH
-
- $0.00 / 1Box
-
2026-01-04
- CAS:91000-69-0
- Min. Order: 1Box
- Purity: 99%
- Supply Ability: 200kg
|
| | FMOC-L-Arginine Basic information |
| | FMOC-L-Arginine Chemical Properties |
| Melting point | 145-150 °C(lit.) | | alpha | 9 º (c=1 DMF 24 ºC) | | Boiling point | 520.14°C (rough estimate) | | density | 1.2722 (rough estimate) | | refractive index | 1.6620 (estimate) | | storage temp. | 2-8°C | | solubility | Aqueous Acid (Slightly), Chloroform (Slightly), Dimethylformamide (Slightly) | | pka | 3.81±0.21(Predicted) | | form | Powder | | color | Off-white | | Optical Rotation | [α]/D +9.0±2.0°, c = 1% in DMF | | Sensitive | Moisture Sensitive | | BRN | 4828015 | | Major Application | peptide synthesis | | InChIKey | DVBUCBXGDWWXNY-SFHVURJKSA-N | | SMILES | C(O)(=O)[C@H](CCCNC(N)=N)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O | | CAS DataBase Reference | 91000-69-0(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 21 | | HS Code | 29252900 | | Storage Class | 11 - Combustible Solids |
| | FMOC-L-Arginine Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | Nα-Fmoc-L-arginine is an N-Fmoc-protected form of L-Arginine (A769505). L-Arginine is an conditionally essential amino acid for humans and adult mammals as it’s requirements exceed production during certain developmental stages in life (such as pregnancy). L-Arginine also prevents blood toxicity from intravenous amino acid administration in humans. | | References | [1] Yi Yang*, Lena Hansen and Per Ryberg. “Side-Chain Unprotected Fmoc-Arg/His/Tyr-OH Couplings and Their Application in Solid-Phase Peptide Synthesis through a Minimal-Protection/Green Chemistry Strategy.” Organic Process Research & Development 26 5 (2022): 1520–1530.
|
| | FMOC-L-Arginine Preparation Products And Raw materials |
|