- D-Histidine
-
-
2026-07-03
- CAS:351-50-8
- Min. Order: 1KG
- Purity: 98.5%-101.5%;AJI92
- Supply Ability: 500KGS
- D-Histidine
-
- $29.00
-
2026-05-11
- CAS:351-50-8
- Purity: 99.57%
- Supply Ability: 10g
- D-Histidine
-
-
2025-04-04
- CAS:351-50-8
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1Ton
|
| | D-Histidine Basic information |
| | D-Histidine Chemical Properties |
| Melting point | 280 °C | | alpha | -12 º (c=11, 6N HCl) | | Boiling point | 278.95°C (rough estimate) | | density | 1.3092 (rough estimate) | | refractive index | -13 ° (C=11, 6mol/L HCl) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | 1 M HCl: soluble | | pka | 1.91±0.10(Predicted) | | form | Free-Flowing Powder | | color | White | | Optical Rotation | 37.9°(C=1.00g/100mL H2O) | | Water Solubility | 42 g/L (25 ºC) | | Merck | 14,4720 | | BRN | 84089 | | Stability: | Hygroscopic | | Major Application | detection
peptide synthesis | | InChI | 1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11)/t5-/m1/s1 | | InChIKey | HNDVDQJCIGZPNO-RXMQYKEDSA-N | | SMILES | N[C@H](Cc1c[nH]cn1)C(O)=O | | LogP | -1.270 | | CAS DataBase Reference | 351-50-8(CAS DataBase Reference) | | EPA Substance Registry System | D-Histidine (351-50-8) |
| Hazard Codes | Xn | | Safety Statements | 22-24/25-36/37-26 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29332900 | | Storage Class | 11 - Combustible Solids |
| | D-Histidine Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | D-Histidine is the unnatural, biologically inactive isomer of L-Histidine (H456010). D-histidine is known to inhibit cell division, and is also used by certain types of bacteria (such as Escherichia coli) as a source of L-Histidine. | | Definition | ChEBI: An optically active form of histidine having D-configuration. | | Biochem/physiol Actions | D-Histidine may be used in the design of peptide drugs, cationic peptides, such as analogues of carnosine. D-Histidine may also be used as a heavy metal sequestration agent. |
| | D-Histidine Preparation Products And Raw materials |
|