3-BROMO-6-CHLORO-2-FLUOROPYRIDINE manufacturers
|
| | 3-BROMO-6-CHLORO-2-FLUOROPYRIDINE Basic information |
| Product Name: | 3-BROMO-6-CHLORO-2-FLUOROPYRIDINE | | Synonyms: | 3-BROMO-6-CHLORO-2-FLUOROPYRIDINE;3-Bromo-6-chloro-2-fluoropyridine, 90+%;Pyridine, 3-bromo-6-chloro-2-fluoro-;2-Chloro-5-bromo-6-fluoropyridine;3-BROMO-6-CHLORO-2-FLUOROPYRIDINE ISO 9001：2015 REACH;2-methylthiazole-8-carboxylic acid | | CAS: | 885952-18-1 | | MF: | C5H2BrClFN | | MW: | 210.43 | | EINECS: | 256-495-9 | | Product Categories: | | | Mol File: | 885952-18-1.mol |  |
| | 3-BROMO-6-CHLORO-2-FLUOROPYRIDINE Chemical Properties |
| Boiling point | 212.0±35.0 °C(Predicted) | | density | 1.829±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | -4.84±0.10(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C5H2BrClFN/c6-3-1-2-4(7)9-5(3)8/h1-2H | | InChIKey | VKBRLJKCZACHPU-UHFFFAOYSA-N | | SMILES | C1(F)=NC(Cl)=CC=C1Br |
| PackingGroup | III | | HS Code | 2933399990 |
| | 3-BROMO-6-CHLORO-2-FLUOROPYRIDINE Usage And Synthesis |
| Uses | 3-Bromo-6-chloro-2-fluoropyridine is a polysubstituted pyridine compound that contains bromine, chlorine and fluorine atom substituents on the benzene ring. It can be used in the preparation of aryl or aza-heteroaryl compounds. |
| | 3-BROMO-6-CHLORO-2-FLUOROPYRIDINE Preparation Products And Raw materials |
|