| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:Butyric--d3 Acid
CAS:36789-14-7
Remarks:CS-C-01827
|
| Company Name: |
ChengDu SinoStandards Bio-Tech Co.,Ltd. ，
|
| Tel: |
028-83243028 19136088901 |
| Email: |
sinostandards@163.com |
| Products Intro: |
Product Name:Butyric-4,4,4-d3 Acid
CAS:36789-14-7
Purity:标准品 Package:10mg;100mg;1g
|
| Company Name: |
Manhag Testing Technology Co., Ltd
|
| Tel: |
400-818 0104 18918165978 |
| Email: |
zilin.ren@bestown.net.cn |
| Products Intro: |
Product Name:Butyric-4,4,4-d3 Acid
CAS:36789-14-7
Purity:10mg Package:10mg
|
| Company Name: |
Yancheng Tongming Biotechnology Co., Ltd.
|
| Tel: |
15195160625 |
| Email: |
2863565288@qq.com |
| Products Intro: |
Product Name:Butyric-4,4,4-d3 Acid
CAS:36789-14-7
Purity:98% HPLC Package:0.25 g In Stock
0.5 g In Stock
|
| Company Name: |
LGC Science (Shanghai) Ltd.
|
| Tel: |
17717235263 |
| Email: |
fan.yang@LGCgroup.com |
| Products Intro: |
Product Name:Butyric-4,4,4-d3 Acid
CAS:36789-14-7
Purity:具体纯度，见COA Package:0.25g Remarks:CDN-D-1201
|
|
| | BUTYRIC-4,4,4-D3 ACID Basic information |
| Product Name: | BUTYRIC-4,4,4-D3 ACID | | Synonyms: | BUTYRIC-4,4,4-D3 ACID;BUTANOIC-4,4,4-D3 ACID;Butyric acid-4,4,4-d3;Butyric--d3 Acid;Butyric acid-4,4,4-d3;Butyric-4,4,4-D3 Acid (Standard) | | CAS: | 36789-14-7 | | MF: | C4H8O2 | | MW: | 88.11 | | EINECS: | | | Product Categories: | | | Mol File: | 36789-14-7.mol |  |
| | BUTYRIC-4,4,4-D3 ACID Chemical Properties |
| Melting point | -6--3 °C(lit.) | | Boiling point | 162 °C(lit.) | | density | 0.996 g/mL at 25 °C | | Fp | 72 °C | | solubility | Methanol (Slightly), Water (Slightly) | | form | Oil | | color | Colourless to Light Yellow | | InChI | 1S/C4H8O2/c1-2-3-4(5)6/h2-3H2,1H3,(H,5,6)/i1D3 | | InChIKey | FERIUCNNQQJTOY-FIBGUPNXSA-N | | SMILES | [2H]C([2H])([2H])CCC(O)=O |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36-45 | | RIDADR | UN 2820 8/PG 3 | | WGK Germany | 1 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Skin Corr. 1B |
| | BUTYRIC-4,4,4-D3 ACID Usage And Synthesis |
| | BUTYRIC-4,4,4-D3 ACID Preparation Products And Raw materials |
|