|
|
| | 2',3'-DIDEOXY-3'-FLUOROURIDINE Basic information |
| Product Name: | 2',3'-DIDEOXY-3'-FLUOROURIDINE | | Synonyms: | URIDINE, 2',3'-DIDEOXY-3'-FLUORO-;3'-FLUORO-2',3'-DIDEOXYURIDINE;5-(2,4-dioxo-1,2,3,4-tetrahydropyrimidine)-3-fluoro-2-hydroxymethyltetrahydrofuran;Fddurd;1-(2,3-DIDEOXY-3-FLUORO-BETA-D-RIBOFURANOSYL)URACIL;2’,3’-Dideoxy-3’-fluorouridine, FddU;2',3'-DIDEOXY-3'-FLUOROURIDINE USP/EP/BP;1-((2R,4S,5R)-4-Fluoro-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione | | CAS: | 41107-56-6 | | MF: | C9H11FN2O4 | | MW: | 230.19 | | EINECS: | 415-360-8 | | Product Categories: | Heterocyclic Compounds | | Mol File: | 41107-56-6.mol |  |
| | 2',3'-DIDEOXY-3'-FLUOROURIDINE Chemical Properties |
| Melting point | 184-188 °C(lit.) | | density | 1.50±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Aqueous Base (Slightly, Sonicated), DMSO (Slightly), Methanol (Slightly), Water | | pka | 9.39±0.10(Predicted) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]20/D +10.5°, c = 0.5 in 1 M NaOH | | BRN | 6064366 | | InChI | 1S/C9H11FN2O4/c10-5-3-8(16-6(5)4-13)12-2-1-7(14)11-9(12)15/h1-2,5-6,8,13H,3-4H2,(H,11,14,15)/t5-,6+,8+/m0/s1 | | InChIKey | BKIUEHLYJFLWPK-SHYZEUOFSA-N | | SMILES | OC[C@H]1O[C@H](C[C@@H]1F)N2C=CC(=O)NC2=O |
| Hazard Codes | Xn | | Risk Statements | 68 | | Safety Statements | 22-36/37 | | WGK Germany | 1 | | HS Code | 29349990 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Muta. 2 |
| | 2',3'-DIDEOXY-3'-FLUOROURIDINE Usage And Synthesis |
| Chemical Properties | Off-white solid | | Uses | 2'',3''-Dideoxy-3''-fluorouridine is a reactant used in the synthesis of 5''-trityl nucleosides as inhibitors of Plasmodium falciparum dUTPase. | | Uses | 2′,3′-Dideoxy-3′-fluorouridine can be used as a starting material in the synthesis of:
- 3′-fluoro 2′,3′-dideoxynucleoside analogs for in vitro antiviral activity studies.
- 3′-fluoro deoxyuridine monophosphate analogs as potential anti parasites.
| | General Description | 2′,3′-Dideoxy-3′-fluorouridine (3′-fluoro-2′,3′-dideoxyuridine, FddUrd) is a fluorinated pyrimidine nucleoside analog of uridine. It has been studied extensively for its potential use as an antiviral agent against HIV. |
| | 2',3'-DIDEOXY-3'-FLUOROURIDINE Preparation Products And Raw materials |
|