|
|
| | (1R,2R,5R)-(+)-2-Hydroxy-3-pinanone Basic information |
| Product Name: | (1R,2R,5R)-(+)-2-Hydroxy-3-pinanone | | Synonyms: | (1R,2R,5R)-(+)-2-HYDROXY-2,6,6-TRIMETHYLBICYCLO[3.1.1]HEPTAN-3-ONE;(1R,2R,5R)-2-HYDROXY-2,6,6-TRIMETHYL-BICYCLO[3.1.1]HEPTAN-3-ONE;(+)-(1R,2R,5R)-2-HYDROXY-3-PINANONE;(1R,2R,5R)-(+)-2-HYDROXY-3-PINANONE;(+)-2-Hydroxy-3-pinanone;(1R，2R，5R)-2-Hydroxy-3-pinnone;(1R,2R,5R)-;(1R,2R,5R)-(+)-2-Hydroxy-3-pinanone> | | CAS: | 24047-72-1 | | MF: | C10H16O2 | | MW: | 168.23 | | EINECS: | | | Product Categories: | Intermediates & Fine Chemicals;Pharmaceuticals;API intermediates;Chiral Reagents;Asymmetric Synthesis;Bicyclic Monoterpenes;Biochemistry;Synthetic Organic Chemistry;Terpenes | | Mol File: | 24047-72-1.mol |  |
| | (1R,2R,5R)-(+)-2-Hydroxy-3-pinanone Chemical Properties |
| Melting point | 37-39 °C (lit.) | | Boiling point | 245 °C (lit.) | | density | 1.059 g/mL at 25 °C (lit.) | | refractive index | 33 ° (C=0.5, CHCl3) | | Fp | 224 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Acetone (Slightly), Chloroform (Slightly), Ethyl Acetate (Slightly) | | pka | 12.93±0.40(Predicted) | | form | Oil | | color | Colourless to Pale Yellow | | Optical Rotation | [α]20/D +39°, c = 0.5 in chloroform | | BRN | 2249018 | | InChI | 1S/C10H16O2/c1-9(2)6-4-7(9)10(3,12)8(11)5-6/h6-7,12H,4-5H2,1-3H3/t6-,7-,10/m1/s1 | | InChIKey | VZRRCQOUNSHSGB-KTWZPZHPSA-N | | SMILES | CC1(C)[C@@H]2C[C@H]1C(C)(O)C(=O)C2 | | CAS DataBase Reference | 24047-72-1(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2914.40.9000 | | Storage Class | 11 - Combustible Solids |
| | (1R,2R,5R)-(+)-2-Hydroxy-3-pinanone Usage And Synthesis |
| Chemical Properties | (1R,2R,5R)-(+)-2-Hydroxy-3-pinanone is white Crystalline Solid | | Uses | (1R,2R,5R)-(+)-2-Hydroxy-3-pinanone is a useful chiral auxillary for synthesis | | Uses | An essential oil from Hyssopus officinalis L. and Cymbopogon jwarancusa (Jones) Schult. It is used in cosmetics. |
| | (1R,2R,5R)-(+)-2-Hydroxy-3-pinanone Preparation Products And Raw materials |
|