| | N-[(tert-Butoxy)carbonyl]-D-tryptophan Basic information |
| | N-[(tert-Butoxy)carbonyl]-D-tryptophan Chemical Properties |
| Melting point | 131-136 °C | | alpha | 19 º (c=1, DMF) | | Boiling point | 445.17°C (rough estimate) | | density | 1.1328 (rough estimate) | | refractive index | 1.5800 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Aqueous Base (Slightly), DMF (Slightly) DMSO (Slightly), Methanol (Slightly) | | pka | 4.00±0.10(Predicted) | | form | Solid | | color | White | | BRN | 4237334 | | Major Application | peptide synthesis | | InChI | 1S/C16H20N2O4/c1-16(2,3)22-15(21)18-13(14(19)20)8-10-9-17-12-7-5-4-6-11(10)12/h4-7,9,13,17H,8H2,1-3H3,(H,18,21)(H,19,20)/t13-/m1/s1 | | InChIKey | NFVNYBJCJGKVQK-CYBMUJFWSA-N | | SMILES | CC(C)(C)OC(=O)N[C@H](Cc1c[nH]c2ccccc12)C(O)=O | | CAS DataBase Reference | 5241-64-5(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| | N-[(tert-Butoxy)carbonyl]-D-tryptophan Usage And Synthesis |
| Chemical Properties | WHITE TO CREAM POWDER | | Uses | Nα-Boc-D-tryptophan is an N-Boc-protected form of D-Tryptophan (T947205). D-Tryptophan is an unnatural isomer of L-Tryptophan (T947210) and is classified as an essential amino acid. D-Tryptophan has been synthesized as part of some potent Oxytocin (Acetate: O878500) antagonists that treat preterm labour. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | N-[(tert-Butoxy)carbonyl]-D-tryptophan Preparation Products And Raw materials |
|