|
|
| | 3-FLUORO-2-NITROBENZOIC ACID Basic information |
| Product Name: | 3-FLUORO-2-NITROBENZOIC ACID | | Synonyms: | 3-FLUORO-2-NITROBENZOIC ACID;3-Fluoro-2-nitrobenzoic acid 98+%;3-Fluoro-2-nitrobenzoic acid 99%;2-Carboxy-6-fluoronitrobenzene;3-Flooro-2-nitrobenzoic acid;Benzoic acid, 3-fluoro-2-nitro-;3-Fluoro-2-nitrobenzoic;DTGONJAUUOWYGB-UHFFFAOYSA-N | | CAS: | 1000339-51-4 | | MF: | C7H4FNO4 | | MW: | 185.11 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 3-FLUORO-2-NITROBENZOIC ACID Chemical Properties |
| Boiling point | 354.2±27.0 °C(Predicted) | | density | 1.568±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 1.85±0.10(Predicted) | | form | Solid | | color | Off-white | | Sensitive | Air Sensitive | | InChI | InChI=1S/C7H4FNO4/c8-5-3-1-2-4(7(10)11)6(5)9(12)13/h1-3H,(H,10,11) | | InChIKey | DTGONJAUUOWYGB-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC(F)=C1[N+]([O-])=O |
| Hazard Codes | Xi | | HS Code | 2916399090 |
| | 3-FLUORO-2-NITROBENZOIC ACID Usage And Synthesis |
| Chemical Properties | light yellow powder | | Uses | 3-Fluoro-2-nitrobenzoic acid is an anhydrous nitrating agent that reacts with 5-fluoro-2-nitrobenzoic acid to produce 3,5-difluoronitrobenzene. 3-Fluoro-2-nitrobenzoic acid can be also used in the production of dyes and pharmaceuticals. |
| | 3-FLUORO-2-NITROBENZOIC ACID Preparation Products And Raw materials |
|