| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Company Name: |
TargetMol |
| Tel: |
400-821-0310 15002144251 |
| Email: |
xuexiang.shao@tsbiochem.com |
|
| | Bepristat 1a Basic information |
| Product Name: | Bepristat 1a | | Synonyms: | Bepristat 1a;Bepristat 1a >=98% (HPLC);4-Piperidinecarboxamide, 1-[(3-chloro-4-hydroxyphenyl)methyl]-N-ethyl-N-methyl-4-(2-phenoxyethyl)- | | CAS: | 1642375-66-3 | | MF: | C24H31ClN2O3 | | MW: | 430.97 | | EINECS: | | | Product Categories: | | | Mol File: | 1642375-66-3.mol |  |
| | Bepristat 1a Chemical Properties |
| Boiling point | 563.1±50.0 °C(Predicted) | | density | 1.190±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: 2mg/mL, clear | | form | powder | | pka | 8.42±0.20(Predicted) | | color | white to light brown | | InChIKey | AYJKPBTXOIHUFT-UHFFFAOYSA-N | | SMILES | ClC1=C(O)C=CC(CN2CCC(C(N(CC)C)=O)(CCOC3=CC=CC=C3)CC2)=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Bepristat 1a Usage And Synthesis |
| Biological Activity | Beprist at 1a is a selective reversible inhibitor of protein disulfide isomerase (PDI), an enzyme in the endoplasmic reticulum th at catalyzes disulfide bond breakage and reformation to catalyze protein folding. Unlike most PDI inhibitors, Beprist at 1a binds at the substrate-binding site, rather than the catalytic site. It blocked PDI activity with an IC50 value of 700 nM. PDI is up-regulated in several cancers, has been implicated in neurodegenerative processes, and plays an important role in thrombus formation. Beprist at 1a potently inhibited platelet aggregation and thrombus formation in vivo. |
| | Bepristat 1a Preparation Products And Raw materials |
|