2-(2-Chlorophenyl)-2-nitrocyclohexanone manufacturers
|
| | 2-(2-Chlorophenyl)-2-nitrocyclohexanone Basic information |
| Product Name: | 2-(2-Chlorophenyl)-2-nitrocyclohexanone | | Synonyms: | 2-(2-Chlorophenyl)-2-nitrocyclohexanone;2-(2-chlorophenyl)-2-nitrocyclohexan-1-one;Ketoclomazone;(2-Chlorophenyl) -2-Nitrocyclohexanone;nitrocyclohexanone;Amino-3,4-dimethylisoxazole;Sles7;2-(2-Chlorophenyl)-2-nitrocyclohexanon | | CAS: | 2079878-75-2 | | MF: | C12H12ClNO3 | | MW: | 253.68 | | EINECS: | 205-516-1 | | Product Categories: | 2079878-75-2 | | Mol File: | 2079878-75-2.mol |  |
| | 2-(2-Chlorophenyl)-2-nitrocyclohexanone Chemical Properties |
| Boiling point | 412.5±45.0 °C(Predicted) | | density | 1.33±0.1 g/cm3(Predicted) | | solubility | DMF: 30 mg/ml DMSO: 10 mg/ml Ethanol: 0.5 mg/ml | | InChI | InChI=1S/C12H12ClNO3/c13-10-6-2-1-5-9(10)12(14(16)17)8-4-3-7-11(12)15/h1-2,5-6H,3-4,7-8H2 | | InChIKey | OBRSWNBWMZPYHU-UHFFFAOYSA-N | | SMILES | C1(=O)CCCCC1(C1=CC=CC=C1Cl)[N+]([O-])=O |
| | 2-(2-Chlorophenyl)-2-nitrocyclohexanone Usage And Synthesis |
| Uses | 2-(2-Chlorophenyl)-2-nitrocyclohexanone is a useful research chemical. | | Application |
2-(2-Chlorophenyl)-2-nitrocyclohexanone (2-CPNCH) is an analytical reference standard and can be a precursor for synthesizing norketamine. This compound is available commercially[1]. 2-(2-Chlorophenyl)-2-nitrocyclohexanone has been found in powders seized by law enforcement. This product is intended for research and forensic applications.
| | References | [1] Yao-Te Yen . “Identification of a novel norketamine precursor from seized powders: 2-(2-chlorophenyl)-2-nitrocyclohexanone.” Forensic science international 333 (2022): Article 111241. |
| | 2-(2-Chlorophenyl)-2-nitrocyclohexanone Preparation Products And Raw materials |
|