|
|
| | 1-Piperidinecarboxylic acid, 2,2-dimethyl-5-oxo-, 1,1-dimethylethyl ester Basic information |
| Product Name: | 1-Piperidinecarboxylic acid, 2,2-dimethyl-5-oxo-, 1,1-dimethylethyl ester | | Synonyms: | 1-Piperidinecarboxylic acid, 2,2-dimethyl-5-oxo-, 1,1-dimethylethyl ester;tert-Butyl 2,2-dimethyl-5-oxopiperidine-1-carboxylate;2,2-dimethyl-5-oxopiperidin-1-carboxylic? acid tert-butyl ester;1-Boc-6,6-dimethylpiperidin-3-one | | CAS: | 1894533-96-0 | | MF: | C12H21NO3 | | MW: | 227.3 | | EINECS: | | | Product Categories: | | | Mol File: | 1894533-96-0.mol |  |
| | 1-Piperidinecarboxylic acid, 2,2-dimethyl-5-oxo-, 1,1-dimethylethyl ester Chemical Properties |
| Boiling point | 303.4±35.0 °C(Predicted) | | density | 1.035±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | -1.58±0.40(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C12H21NO3/c1-11(2,3)16-10(15)13-8-9(14)6-7-12(13,4)5/h6-8H2,1-5H3 | | InChIKey | OSXYWCDUZJABRB-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CC(=O)CCC1(C)C |
| | 1-Piperidinecarboxylic acid, 2,2-dimethyl-5-oxo-, 1,1-dimethylethyl ester Usage And Synthesis |
| | 1-Piperidinecarboxylic acid, 2,2-dimethyl-5-oxo-, 1,1-dimethylethyl ester Preparation Products And Raw materials |
|