|
|
| | 1-Piperidinecarboxylic acid, 5-methyl-2-oxo-, 1,1-dimethylethyl ester, (5S)- Basic information |
| Product Name: | 1-Piperidinecarboxylic acid, 5-methyl-2-oxo-, 1,1-dimethylethyl ester, (5S)- | | Synonyms: | 1-Piperidinecarboxylic acid, 5-methyl-2-oxo-, 1,1-dimethylethyl ester, (5S)-;(S)-tert-Butyl 5-methyl-2-oxopiperidine-1-carboxylate;tert-butyl (5S)-5-methyl-2-oxo-piperidine-1-carboxylate;(S)-1-Boc-5-methylpiperidin-2-one;tert-butyl (S)-5-methyl-2-oxopiperidine-1-carboxylate;(S)-tert-Butyl 5-methyl-2-oxopiperidine-1-carboxylate - [B92193] | | CAS: | 1572246-00-4 | | MF: | C11H19NO3 | | MW: | 213.27 | | EINECS: | | | Product Categories: | | | Mol File: | 1572246-00-4.mol |  |
| | 1-Piperidinecarboxylic acid, 5-methyl-2-oxo-, 1,1-dimethylethyl ester, (5S)- Chemical Properties |
| Boiling point | 326.4±11.0 °C(Predicted) | | density | 1.060±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | -2.25±0.40(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C11H19NO3/c1-8-5-6-9(13)12(7-8)10(14)15-11(2,3)4/h8H,5-7H2,1-4H3/t8-/m0/s1 | | InChIKey | MAKAGQOJZISZCH-QMMMGPOBSA-N | | SMILES | N1(C(OC(C)(C)C)=O)C[C@@H](C)CCC1=O |
| | 1-Piperidinecarboxylic acid, 5-methyl-2-oxo-, 1,1-dimethylethyl ester, (5S)- Usage And Synthesis |
| | 1-Piperidinecarboxylic acid, 5-methyl-2-oxo-, 1,1-dimethylethyl ester, (5S)- Preparation Products And Raw materials |
|