|
|
| | Fmoc-D-glutamic acid gamma-tert-butyl ester Basic information |
| | Fmoc-D-glutamic acid gamma-tert-butyl ester Chemical Properties |
| Melting point | 83-89 °C | | Boiling point | 633.5±55.0 °C(Predicted) | | density | 1.232±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 3.70±0.10(Predicted) | | form | Solid | | color | White to Almost white | | Optical Rotation | [α]/D +4.5±1, c = 1 in acetic acid: water (4:1) | | Water Solubility | Slightly soluble in water. | | Major Application | peptide synthesis | | InChIKey | OTKXCALUHMPIGM-HXUWFJFHSA-N | | SMILES | C(O)(=O)[C@@H](CCC(OC(C)(C)C)=O)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O | | CAS DataBase Reference | 104091-08-9(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 2924 29 70 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-D-glutamic acid gamma-tert-butyl ester Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | It is an important raw material and intermediate used in organic synthesis, agrochemicals and dyestuff. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-D-glutamic acid gamma-tert-butyl ester Preparation Products And Raw materials |
|