- Medetomidine Impurity
-
- $0.00 / 10mg
-
2025-12-16
- CAS:60907-88-2
- Min. Order: 10mg
- Purity: 95%+
- Supply Ability: 100000
|
| | 1-(2,3-Dimethylphenyl)ethyl chloride Basic information |
| Product Name: | 1-(2,3-Dimethylphenyl)ethyl chloride | | Synonyms: | 1-(2,3-dimethylphenyl)ethyl chloride;1-(1-chloroethyl)-2,3-dimethylbenzene;1-(1-CHLOROETHYL)-2,3-DIMETHYLPHENYL;1-(1-chlorethyl)-2,3-dimethylbenzylidene;Medetomidine Impurity 30;Benzene,1-(1-chloroethyl)-2,3-dimethyl-;3-Dimethylphenyl)ethyl chloride;1-(2,3-Dimethylphenyl)ethyl chloride ISO 9001：2015 REACH | | CAS: | 60907-88-2 | | MF: | C10H13Cl | | MW: | 168.66 | | EINECS: | 1308068-626-2 | | Product Categories: | 60907-88-2 | | Mol File: | 60907-88-2.mol |  |
| | 1-(2,3-Dimethylphenyl)ethyl chloride Chemical Properties |
| Boiling point | 233°C | | density | 1.010 | | Fp | 93°C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Clear colourless to Dark Brown | | InChI | InChI=1S/C10H13Cl/c1-7-5-4-6-10(8(7)2)9(3)11/h4-6,9H,1-3H3 | | InChIKey | QCZFALDMBXRELM-UHFFFAOYSA-N | | SMILES | C1(C(Cl)C)=CC=CC(C)=C1C |
| | 1-(2,3-Dimethylphenyl)ethyl chloride Usage And Synthesis |
| Uses | 1-(2,3-Dimethylphenyl)ethyl Chloride is an impurity of Medetomidine (M203250), an a2-Adrenergic agonist. Sedative |
| | 1-(2,3-Dimethylphenyl)ethyl chloride Preparation Products And Raw materials |
|