|
|
| | 4,4'-Sulfonylbis(2,6-dibromophenol) Basic information |
| Product Name: | 4,4'-Sulfonylbis(2,6-dibromophenol) | | Synonyms: | 4,4'-sulphonylbis(2,6-dibromophenol);4,4''-SULFONYLBIS[2,6-DIBROMO-PHENO,95%;3,3',5,5'-Tetrabromo-4,4'-dihydroxydiphenylsulfone;4,4'-Sulphonylbis(2,6-dibromophenol)(Tetrabromobisphenol S);Bis(4-hydroxy-3,5-dibromophenyl) sulfone;3,3,5,5-TetrabromobisphenolS;3,3,5,5-TetrabromoBisphenol-S;2,6-dibromo-4-(4-hydroxyphenyl)sulfonylphenol | | CAS: | 39635-79-5 | | MF: | C12H6Br4O4S | | MW: | 565.85 | | EINECS: | 254-551-9 | | Product Categories: | | | Mol File: | 39635-79-5.mol |  |
| | 4,4'-Sulfonylbis(2,6-dibromophenol) Chemical Properties |
| Boiling point | 539.4±50.0 °C(Predicted) | | density | 2.363±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Sparingly), Methanol (Slightly) | | form | Solid | | pka | 3.53±0.25(Predicted) | | color | Off-White to Pale Beige | | Stability: | Light sensitive | | InChI | InChI=1S/C12H6Br4O4S/c13-7-1-5(2-8(14)11(7)17)21(19,20)6-3-9(15)12(18)10(16)4-6/h1-4,17-18H | | InChIKey | JHJUYGMZIWDHMO-UHFFFAOYSA-N | | SMILES | S(C1=CC(Br)=C(O)C(Br)=C1)(C1=CC(Br)=C(O)C(Br)=C1)(=O)=O | | CAS DataBase Reference | 39635-79-5(CAS DataBase Reference) | | EPA Substance Registry System | Phenol, 4,4'-sulfonylbis[2,6-dibromo- (39635-79-5) |
| RIDADR | 3152 | | TSCA | TSCA listed | | HazardClass | 9 | | PackingGroup | II |
| | 4,4'-Sulfonylbis(2,6-dibromophenol) Usage And Synthesis |
| Uses | 4,4'-sulphonylbis(2,6-dibromophenol) is reactive flame retardant, used in epoxy resin, polycarbonate resin, polyester, phenolic resin, polysulfone, polyether sulfone, can also be used as additive of ABS. HIPS unsaturated polyesters, adhesives, coatings, etc., also used as the intermediate of organic synthesis. Characteristics are high efficient flame retardant, and strong heat resistance . |
| | 4,4'-Sulfonylbis(2,6-dibromophenol) Preparation Products And Raw materials |
|