Perfluoro-2,5-dimethyl-3,6-dioxanonanoic acid manufacturers
|
| | Perfluoro-2,5-dimethyl-3,6-dioxanonanoic acid Basic information | | Uses |
| Product Name: | Perfluoro-2,5-dimethyl-3,6-dioxanonanoic acid | | Synonyms: | 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanoic acid;2-(1,1,2,3,3,3-hexafluoro-2-(heptafluoropropoxy)propoxy)-2,3,3,3-tetrafluoro;3,6-dioxa-2,5-di(trifluoromethyl)-undecafluoro-nonanoicaciacidfluoride;3-tetrafluoro-;propanoicacid,2-(1,1,2,3,3,3-hexafluoro-2-(heptafluoropropoxy)propoxy)-2,3,3,;2,4,4,5,7,7,8,8,9,9,9-Undecafluoro-2,5-bis(trifluoromethyl)-3,6-dioxanonanoic acid;2-[2-(Heptafluoropropoxy)-1,1,2,3,3,3-hexafluoropropoxy]-2,3,3,3-tetrafluoropropionic acid;2-[2-(Heptafluoropropoxy)hexafluoropropoxy]tetrafluoropropanoic acid | | CAS: | 13252-14-7 | | MF: | C9HF17O4 | | MW: | 496.07 | | EINECS: | 236-237-3 | | Product Categories: | | | Mol File: | 13252-14-7.mol |  |
| | Perfluoro-2,5-dimethyl-3,6-dioxanonanoic acid Chemical Properties |
| Boiling point | 263.2±40.0 °C(Predicted) | | density | 1.736 | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | pka | -1.26±0.10(Predicted) | | color | Colourless | | InChI | InChI=1S/C9HF17O4/c10-2(1(27)28,5(14,15)16)29-9(25,26)4(13,7(20,21)22)30-8(23,24)3(11,12)6(17,18)19/h(H,27,28) | | InChIKey | OIVQVBDAMYDDEM-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F | | EPA Substance Registry System | Propanoic acid, 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(heptafluoropropoxy)propoxy]- (13252-14-7) |
| | Perfluoro-2,5-dimethyl-3,6-dioxanonanoic acid Usage And Synthesis |
| Uses | Perfluoro-2,5-dimethyl-3,6-dioxanonanoic acid is a colorless liquid that can be used as a fluorine-containing material. | | Chemical Properties | colorless to clear liquid | | Hazard | Moderately toxic by inhalation and skin
contact. A moderate eye irritant |
| | Perfluoro-2,5-dimethyl-3,6-dioxanonanoic acid Preparation Products And Raw materials |
|