|
|
| | Piperazine-1,4-diethylamine Basic information |
| Product Name: | Piperazine-1,4-diethylamine | | Synonyms: | piperazine-1,4-diethylamine;1,4-Piperazinediethanamine;1,4-Piperazinediethanamine(9CI);1,4-Bis(2-aminoethyl)piperazine;1,4-Piperazinediethaneamine;2-[4-(2-Aminoethyl)piperazin-1-yl]ethylamine;Einecs 229-428-8;2,2''-PIPERAZINE-1,4-DIYLDIETHANAMINE | | CAS: | 6531-38-0 | | MF: | C8H20N4 | | MW: | 172.27 | | EINECS: | 229-428-8 | | Product Categories: | PIPERIDINE | | Mol File: | 6531-38-0.mol |  |
| | Piperazine-1,4-diethylamine Chemical Properties |
| Melting point | 40 °C | | Boiling point | 130 °C(Press: 12 Torr) | | density | 0.9675 g/cm3(Temp: 25 °C) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | Solid | | pka | 10.41±0.10(Predicted) | | InChI | InChI=1S/C8H20N4/c9-1-3-11-5-7-12(4-2-10)8-6-11/h1-10H2 | | InChIKey | PAOXFRSJRCGJLV-UHFFFAOYSA-N | | SMILES | N1(CCN)CCN(CCN)CC1 | | NIST Chemistry Reference | N,N'-Di-(2-aminoethyl)piperazine(6531-38-0) | | EPA Substance Registry System | 1,4-Piperazinediethanamine (6531-38-0) |
| RIDADR | 1760 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II |
| | Piperazine-1,4-diethylamine Usage And Synthesis |
| Uses | 1,4-Piperazinediethylamine-d8 is the isotope labelled analog of 1,4-Piperazinediethylamine (P480090); a reagent in the synthesis of bis-thiazolone derivatives as micromolar CDC25 phosphatase inhibitors. Also used as a reagent in the synthesis of novel bisnaphthalimides as new DNA topoisomerase II inhibitors. |
| | Piperazine-1,4-diethylamine Preparation Products And Raw materials |
|