2-oxoglutaric acid, compound with 5-hydroxy-6-methylpyridine-3,4-dimethanol (1:1) manufacturers
|
| | 2-oxoglutaric acid, compound with 5-hydroxy-6-methylpyridine-3,4-dimethanol (1:1) Basic information |
| | 2-oxoglutaric acid, compound with 5-hydroxy-6-methylpyridine-3,4-dimethanol (1:1) Chemical Properties |
| Melting point | 120.5-121.5 °C | | storage temp. | 2-8°C | | InChI | InChI=1S/C8H11NO3.C5H6O5/c1-5-8(12)7(4-11)6(3-10)2-9-5;6-3(5(9)10)1-2-4(7)8/h2,10-12H,3-4H2,1H3;1-2H2,(H,7,8)(H,9,10) | | InChIKey | MLAUVUHGQARGDU-UHFFFAOYSA-N | | SMILES | C1(CO)=C(O)C(=NC=C1CO)C.C(CC(=O)O)C(=O)C(=O)O |
| Toxicity | mouse,LD50,intramuscular,2472mg/kg (2472mg/kg),British UK Patent Application. Vol. #2084018, |
| | 2-oxoglutaric acid, compound with 5-hydroxy-6-methylpyridine-3,4-dimethanol (1:1) Usage And Synthesis |
| | 2-oxoglutaric acid, compound with 5-hydroxy-6-methylpyridine-3,4-dimethanol (1:1) Preparation Products And Raw materials |
|