|
|
| | 1-(4-bromophenyl)-2-chloroethan-1-one Basic information |
| Product Name: | 1-(4-bromophenyl)-2-chloroethan-1-one | | Synonyms: | 1-(4-bromophenyl)-2-chloroethan-1-one;4'-Bromo-α-chloroacetophenone;p-Bromo-2-chloroacetophenone;Ethanone, 1-(4-bromophenyl)-2-chloro-;4'-Bromo-2-Chloroacetophenone;2-chloro-4'-bromoacetophenone | | CAS: | 4209-02-3 | | MF: | C8H6BrClO | | MW: | 233.49 | | EINECS: | 224-134-6 | | Product Categories: | | | Mol File: | 4209-02-3.mol |  |
| | 1-(4-bromophenyl)-2-chloroethan-1-one Chemical Properties |
| Melting point | 119-120 °C | | Boiling point | 306.7±22.0 °C(Predicted) | | density | 1.571±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C8H6BrClO/c9-7-3-1-6(2-4-7)8(11)5-10/h1-4H,5H2 | | InChIKey | HCQNNQFCUAGJBD-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(Br)C=C1)CCl |
| | 1-(4-bromophenyl)-2-chloroethan-1-one Usage And Synthesis |
| Uses | 2-Chloro-4''-bromoacetophenone | | Synthesis | General procedure for the synthesis of 2'-chloro-4-bromoacetophenone from p-bromoacetophenone: [TABLE-US-00002] (18) Acetophenone Derivative R13 R14 1 NO2 H 2 NO2 Cl 3 H Br 4 H H. Acetophenone derivatives shown in Eqn. (18) (2.00 g) was dissolved or suspended in a solvent, and sulfonyl chloride as shown in Table 2 was added in a single addition under stirring (molar concentration M based on acetophenone derivative). The reaction temperature and reaction time are shown in Table 2. [Table-US-00003] Table 2: Acetophenone derivatives, SO2Cl2 (equivalent), solvent (M), temperature, time (hr) and yield (%). Examples: 42 MTBE(0.5)1 3.0 room temperature 4.5 50.8; 43 MTBE(1)1 1.65 reflux 7.0 70.1; 44 IPE(1)1 3.0 room temperature 3.0 77.8; 45 DME(1)1 1.65 room temperature 4.0 71.4; 46 MTBE(1)3 3.0 room temperature 1.0 50.3; 47 MTBE(1)4 1.1 room temperature 7.0 78.9. Note: MTBE is methyl tert-butyl ether; IPE is diisopropyl ether; DME is 1,2-dimethoxyethane. | | References | [1] Synthesis, 1988, # 7, p. 545 - 546
[2] Synthetic Communications, 2006, vol. 36, # 2, p. 255 - 258
[3] Green Chemistry, 2009, vol. 11, # 2, p. 275 - 278
[4] Synthetic Communications, 2011, vol. 41, # 10, p. 1508 - 1513
[5] Tetrahedron Letters, 2004, vol. 45, # 1, p. 191 - 193 |
| | 1-(4-bromophenyl)-2-chloroethan-1-one Preparation Products And Raw materials |
| Raw materials | Ethanone, 1-(4-bromophenyl)-2,2,2-trichloro--->Benzene, 1-bromo-4-(2-chloroethynyl)--->Ethanone, 1-(4-bromophenyl)-2-iodo--->BenzeneMethanol, 4-broMo-.alpha.-(trichloroMethyl)--->4-Bromophenylacetylene-->Ethanone, 1-(4-bromophenyl)-2-fluoro- (9CI)-->1-(4-Bromophenyl)ethanol-->2-Bromo-4'-methylacetophenone-->4-Bromostyrene-->4'-Bromoacetophenone-->4-Bromobenzoyl chloride-->Methyl 4-bromobenzoate-->N-Methyl-N-nitrosotoluene-4-sulphonamide-->2,4'-Dibromoacetophenone-->Chloroacetyl chloride-->Chloroacetic acid | | Preparation Products | Ethanone, 1-(4-bromophenyl)-2,2-dichloro- |
|