- diisopentyl phthalate
-
- $1000.00
-
2026-02-02
- CAS:605-50-5
- Min. Order: 1KG
- Purity: 98%HPLC
- Supply Ability: 200tons
|
| | diisopentyl phthalate Basic information |
| | diisopentyl phthalate Chemical Properties |
| Melting point | 334 °C (decomp) | | Boiling point | bp40 225° | | density | 1.028 | | vapor pressure | 0.025Pa at 25℃ | | refractive index | 1.4871 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Liquid | | Appearance | Colorless to light yellow Liquid | | Major Application | environmental | | InChI | InChI=1S/C18H26O4/c1-13(2)9-11-21-17(19)15-7-5-6-8-16(15)18(20)22-12-10-14(3)4/h5-8,13-14H,9-12H2,1-4H3 | | InChIKey | JANBFCARANRIKJ-UHFFFAOYSA-N | | SMILES | C1(C(OCCC(C)C)=O)=CC=CC=C1C(OCCC(C)C)=O | | LogP | 5.6 at 25℃ |
| Risk Statements | 61-60-50/53 | | Safety Statements | 53-61 | | RIDADR | 3082 | | WGK Germany | WGK 3 | | HS Code | 29173410 | | Storage Class | 6.1C - Combustible, acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Aquatic Acute 1 Repr. 1B Skin Sens. 1 |
| | diisopentyl phthalate Usage And Synthesis |
| Chemical Properties | Clear Colourless Oil | | Uses | Plasticizer for nitrocellulose and resin lacquers; preventing foam in manufacture of glue; in rubber cements. | | Uses | One of the several phthalate esters which showed clear fetotoxicity, embryolethality and teratogenicity. |
| | diisopentyl phthalate Preparation Products And Raw materials |
|