|
|
| | Hypoxanthine monosodium Basic information |
| Product Name: | Hypoxanthine monosodium | | Synonyms: | Hypoxanthine monosodium;1,2,3,9-Tetrahydro-6H-purin-6-one sodium salt;1,7-Dihydro-6H-purin-6-one monosodium salt;3,7-dihydropurin-6-one,sodium;Hypoxanthine Monosodium Salt 98%;Hypoxanthine Monosodium 98%;Hypoxanthine sodium 98%;Hypoxanthine Monosodium Salt 98% cas 45738-97-4 | | CAS: | 45738-97-4 | | MF: | C5H4N4O.Na | | MW: | 159.1 | | EINECS: | 816-307-5 | | Product Categories: | | | Mol File: | 45738-97-4.mol |  |
| | Hypoxanthine monosodium Chemical Properties |
| density | 1.83g/cm3 at 20℃ | | vapor pressure | 0-0Pa at 20-25℃ | | solubility | Water (Slightly) | | form | Solid:crystalline | | Stability: | Hygroscopic | | InChI | InChI=1S/C5H4N4O.Na/c10-5-3-4(7-1-6-3)8-2-9-5;/h1-2H,(H2,6,7,8,9,10);/q;+1/p-1 | | InChIKey | KSQGJUORFCVRTI-UHFFFAOYSA-M | | SMILES | N1=C(C2N=CNC=2N=C1)[O-].[Na+] | | LogP | -3.98 at 20℃ |
| | Hypoxanthine monosodium Usage And Synthesis |
| Uses | Hypoxanthine Monosodium Salt can be used for cell culture in culture media free of components of animal origin. |
| | Hypoxanthine monosodium Preparation Products And Raw materials |
|