|
|
| | (R)-2-tert-Butoxycarbonylamino-4,4-difluoro-butyric acid Basic information |
| Product Name: | (R)-2-tert-Butoxycarbonylamino-4,4-difluoro-butyric acid | | Synonyms: | (R)-2-tert-Butoxycarbonylamino-4,4-difluoro-butyric acid;Butanoic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-4,4-difluoro-, methyl ester, (2R)-;Methyl (R)-2-((tert-butoxycarbonyl)amino)-4,4-difluorobutanoate;(R)-2-tert-Butoxycarbonylamino-4,4-difluoro-butyric acid methyl ester | | CAS: | 944328-83-0 | | MF: | C10H17F2NO4 | | MW: | 253.24 | | EINECS: | | | Product Categories: | | | Mol File: | 944328-83-0.mol |  |
| | (R)-2-tert-Butoxycarbonylamino-4,4-difluoro-butyric acid Chemical Properties |
| Boiling point | 300.4±42.0 °C(Predicted) | | density | 1.145±0.06 g/cm3(Predicted) | | pka | 10+-.0.46(Predicted) | | InChI | InChI=1S/C10H17F2NO4/c1-10(2,3)17-9(15)13-6(5-7(11)12)8(14)16-4/h6-7H,5H2,1-4H3,(H,13,15)/t6-/m1/s1 | | InChIKey | SRJNSQAUCPDXSN-ZCFIWIBFSA-N | | SMILES | C(OC)(=O)[C@H](NC(OC(C)(C)C)=O)CC(F)F |
| | (R)-2-tert-Butoxycarbonylamino-4,4-difluoro-butyric acid Usage And Synthesis |
| | (R)-2-tert-Butoxycarbonylamino-4,4-difluoro-butyric acid Preparation Products And Raw materials |
|