| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4,4'-diamino-3,3'-biphenyldisulfonic acid Basic information |
| Product Name: | 4,4'-diamino-3,3'-biphenyldisulfonic acid | | Synonyms: | 4,4'-diamino-3,3'-biphenyldisulfonic acid;4,4'-Diamino-(1,1'-biphenyl)-3,3'-disulfonic acid;Benzidine-3,3''-disulfonic acid;2-amino-5-(4-amino-3-sulfophenyl)benzenesulfonic acid;2-amino-5-(4-amino-3-sulfo-phenyl)benzenesulfonic acid;2-azanyl-5-(4-azanyl-3-sulfo-phenyl)benzenesulfonic acid;4,4'-diaminobiphenyl-3,3'-disulphonic acid;DK7712 | | CAS: | 3365-90-0 | | MF: | C12H12N2O6S2 | | MW: | 344.36 | | EINECS: | | | Product Categories: | | | Mol File: | 3365-90-0.mol |  |
| | 4,4'-diamino-3,3'-biphenyldisulfonic acid Chemical Properties |
| density | 1.681±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | -1.97±0.50(Predicted) | | Appearance | Off-white to gray Solid | | InChI | InChI=1S/C12H12N2O6S2/c13-9-3-1-7(5-11(9)21(15,16)17)8-2-4-10(14)12(6-8)22(18,19)20/h1-6H,13-14H2,(H,15,16,17)(H,18,19,20) | | InChIKey | NFSOOPQRTBEFDR-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(N)C(S(O)(=O)=O)=C2)=CC=C(N)C(S(O)(=O)=O)=C1 |
| | 4,4'-diamino-3,3'-biphenyldisulfonic acid Usage And Synthesis |
| Description | 4,4'-diamino-3,3'-biphenyldisulfonic acid is virtually insoluble in alcohol and ether, very slightly soluble in boiling water. Benzidine-3,3' -disulfonic acid is made by reacting one part of benzidine sulfate with two parts of sulfuric acid monohydrate at 210 ℃. | | Uses | 4,4'-Diamino-3,3'-biphenyldisulfonic acid is used as a ligand in the synthesis of MOF materials. |
| | 4,4'-diamino-3,3'-biphenyldisulfonic acid Preparation Products And Raw materials |
| Preparation Products | Direct Orange 4-->[1,1'-Biphenyl]-3,3'-disulfonic acid, 4,4'-bis[[1-hydroxy-6-[(5-hydroxy-7-sulfo-2-naphthalenyl)amino]-3-sulfo-2-naphthalenyl]azo]-, hexasodium salt-->Benzoic acid, 4-[[7-[[4-[[4'-[[4-[(7-amino-1-hydroxy-3,6-disulfo-2-naphthalenyl)azo]-5-methoxy-2-methylphenyl]azo]-3,3'-disulfo[1,1'-biphenyl]-4-yl]azo]-2-methoxy-5-methylphenyl]azo]-8-hydroxy-6-sulfo-2-naphthalenyl]amino]-, hexasodium salt |
|