| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:Benzyldimethylhexylammonium chloride >=96.0% (AT)
CAS:22559-57-5
Remarks:SR15010016
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Benzyldimethylhexylammonium chloride
CAS:22559-57-5
Purity:>=96.0% (AT) Package:5G Remarks:689718-5G
|
|
| | Benzyldimethylhexylammonium chloride Basic information |
| Product Name: | Benzyldimethylhexylammonium chloride | | Synonyms: | Benzyldimethylhexylammonium chloride;Benzylhexyldimethylammonium chloride;benzyl-hexyl-dimethylazanium:chloride;Benzyldimethylhexylammonium chloride >=96.0% (AT);n-Benzyl-n,n-dimethylhexan-1-aminium chloride | | CAS: | 22559-57-5 | | MF: | C15H26ClN | | MW: | 255.82664 | | EINECS: | | | Product Categories: | | | Mol File: | 22559-57-5.mol |  |
| | Benzyldimethylhexylammonium chloride Chemical Properties |
| form | powder | | BRN | 4045485 | | InChI | 1S/C15H26N.ClH/c1-4-5-6-10-13-16(2,3)14-15-11-8-7-9-12-15;/h7-9,11-12H,4-6,10,13-14H2,1-3H3;1H/q+1;/p-1 | | InChIKey | BNDXNEVHWSOJGV-UHFFFAOYSA-M | | SMILES | [Cl-].CCCCCC[N+](C)(C)Cc1ccccc1 |
| Hazard Codes | C,N | | Risk Statements | 21/22-34-50 | | Safety Statements | 26-36/37/39-45-61 | | RIDADR | UN 2923 8/PG 3 | | WGK Germany | 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Skin Corr. 1B |
| | Benzyldimethylhexylammonium chloride Usage And Synthesis |
| | Benzyldimethylhexylammonium chloride Preparation Products And Raw materials |
|