| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | R(+)-SKF-81297 hydrobromide selective d1 dopamine Basic information |
| | R(+)-SKF-81297 hydrobromide selective d1 dopamine Chemical Properties |
| solubility | H2O: soluble6mg/mL | | form | solid | | color | white to off-white | | Optical Rotation | [α]22/D +15.14°, c = 0.52 in DMF(lit.) | | Water Solubility | H2O: 6mg/mL
DMSO: soluble | | InChI | 1S/C16H16ClNO2.BrH/c17-15-11-6-7-18-9-13(10-4-2-1-3-5-10)12(11)8-14(19)16(15)20;/h1-5,8,13,18-20H,6-7,9H2;1H/t13-;/m1./s1 | | InChIKey | RMIJGBMRNYUZRG-BTQNPOSSSA-N | | SMILES | Br[H].Oc1cc2[C@H](CNCCc2c(Cl)c1O)c3ccccc3 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | R(+)-SKF-81297 hydrobromide selective d1 dopamine Usage And Synthesis |
| Uses | R(+)-SKF-81297 Hydrobromide is a dopamine D1 agonist. | | Uses | R(+)-SKF-81297 hydrobromide has used as D1-type dopamine receptor agonist:
- to test it effect on the spike firing in rat retinal ganglion cells
- in human embryonic kidney (HEK) 293T cells
- to test its inhibitory effect in microglial cells
| | Biochem/physiol Actions | SKF-81297 administration in spontaneously hypertensive rats (SHR) induces an increase in expression of proto-oncogene c-fos mRNA leading to biphasic effect on locomotion. It favors the turnover of phosphoinositide and adenylyl cyclase. SKF-81297 is involved in the stimulation of neurons, in particular the postsynaptic striatal neurons. |
| | R(+)-SKF-81297 hydrobromide selective d1 dopamine Preparation Products And Raw materials |
|