- Boc-Cys(Bzl)-OH
-
- $0.00 / 25Kg/Drum
-
2026-01-27
- CAS:5068-28-0
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 500kgs
- Boc-Cys(Bzl)-OH
-
- $5.00 / 25kg
-
2024-04-27
- CAS:5068-28-0
- Min. Order: 1kg
- Purity: 99.92%
- Supply Ability: 50000tons
|
| | Boc-S-Benzyl-L-cysteine Basic information |
| | Boc-S-Benzyl-L-cysteine Chemical Properties |
| Melting point | 86-88 °C | | alpha | -44.5 º (c=1, acetic acid) | | Boiling point | 481.2±45.0 °C(Predicted) | | density | 1.2189 (rough estimate) | | refractive index | -45 ° (C=1, AcOH) | | storage temp. | Sealed in dry,2-8°C | | solubility | DMSO, Methanol | | pka | 3.58±0.10(Predicted) | | form | Solid | | color | White | | Optical Rotation | [α]20/D 44±1°, c = 1% in acetic acid | | BRN | 2000417 | | Major Application | peptide synthesis | | InChI | 1S/C15H21NO4S/c1-15(2,3)20-14(19)16-12(13(17)18)10-21-9-11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3,(H,16,19)(H,17,18)/t12-/m0/s1 | | InChIKey | IFVORPLRHYROAA-LBPRGKRZSA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](CSCc1ccccc1)C(O)=O | | CAS DataBase Reference | 5068-28-0(CAS DataBase Reference) | | EPA Substance Registry System | L-Cysteine, N-[(1,1-dimethylethoxy)carbonyl]-S-(phenylmethyl)- (5068-28-0) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29309090 | | Storage Class | 11 - Combustible Solids |
| | Boc-S-Benzyl-L-cysteine Usage And Synthesis |
| Chemical Properties | Boc-S-Benzyl-L-cysteine is WHITE MICRO-CRYSTALLINE POWDER | | Uses | Boc-S-Benzyl-L-cysteine is used in peptide HIV1 enzymic synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-S-Benzyl-L-cysteine Preparation Products And Raw materials |
|