- Estratetraenol
-
-
2026-05-29
- CAS:1150-90-9
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 1kg
- Estratetraenol
-
- $500.00
-
2026-02-02
- CAS:1150-90-9
- Purity: 98%
- Supply Ability: 2TONS
|
| | Estratetraenol Basic information |
| Product Name: | Estratetraenol | | Synonyms: | 16-estratetraen-3-ol;Estra-1,3,5(10),16-Tetraen-3-Ol;Estratetraenol;(8S,9S,13S,14S)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]ph enanthren-3-ol;1,3,5(10),16-Estratetren-3-ol;1,3,5(10),16-Estratetraen-3-ol;(8S,9S,13R,14S)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-ol;CoMpound 742 | | CAS: | 1150-90-9 | | MF: | C18H22O | | MW: | 254.37 | | EINECS: | | | Product Categories: | Steroids | | Mol File: | 1150-90-9.mol |  |
| | Estratetraenol Chemical Properties |
| Melting point | 130-131.5 °C | | Boiling point | 400.2±45.0 °C(Predicted) | | density | 1.111±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 14.03±0.40(Predicted) | | color | White to Pale Yellow | | Cosmetics Ingredients Functions | FRAGRANCE | | InChI | InChI=1S/C18H22O/c1-18-9-2-3-17(18)16-6-4-12-11-13(19)5-7-14(12)15(16)8-10-18/h2,5,7,9,11,15-17,19H,3-4,6,8,10H2,1H3/t15-,16-,17+,18+/m1/s1 | | InChIKey | CRMOMCHYBNOFIV-BDXSIMOUSA-N | | SMILES | C1(O)=CC2=C(C=C1)[C@]1([H])[C@]([H])([C@@]3([H])[C@@](CC1)(C)C=CC3)CC2 | | LogP | 5.720 (est) |
| | Estratetraenol Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | A steroid produced by females having pheromone activities. | | Definition | ChEBI: A 3-hydroxy steroid that is obtained by formal dehydration at the 17-position of estradiol. |
| | Estratetraenol Preparation Products And Raw materials |
|