3,5-DIMETHOXYBENZOYL CHLORIDE manufacturers
|
| | 3,5-DIMETHOXYBENZOYL CHLORIDE Basic information |
| | 3,5-DIMETHOXYBENZOYL CHLORIDE Chemical Properties |
| Melting point | 43-46 °C (lit.) | | Boiling point | 157-158 °C/16 mmHg (lit.) | | density | 1.2799 (rough estimate) | | refractive index | 1.5230 (estimate) | | Fp | >230 °F | | storage temp. | RT, stored under nitrogen | | form | powder to lump | | color | White to Light yellow | | Water Solubility | It hydrolyzes in water. | | Sensitive | Moisture Sensitive | | BRN | 511839 | | InChI | InChI=1S/C9H9ClO3/c1-12-7-3-6(9(10)11)4-8(5-7)13-2/h3-5H,1-2H3 | | InChIKey | FTHPLWDYWAKYCY-UHFFFAOYSA-N | | SMILES | C(Cl)(=O)C1=CC(OC)=CC(OC)=C1 | | CAS DataBase Reference | 17213-57-9(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | F | 10-19-21 | | HS Code | 2916.39.7900 | | HazardClass | 8 | | PackingGroup | II | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 3,5-DIMETHOXYBENZOYL CHLORIDE Usage And Synthesis |
| Chemical Properties | off-white to light brown crystalline powder | | Uses | 3,5-Dimethoxybenzoyl chloride was used to study the mechanism and kinetics of solvolysis of 3,4- and 3,5-dimethoxybenzoyl chlorides in various binary solvents. 3,5-Dimethoxybenzoyl chloride undergoes addition reaction with 4,4-dimethyl-2-pentyne in presence of AlCl3 via 1,2- methyl shift. It is used as a chemical and organic intermediate. | | General Description | 3,5-Dimethoxybenzoyl chloride undergoes addition reaction with 4,4-dimethyl-2-pentyne in presence of AlCl3 via 1,2- methyl shift. |
| | 3,5-DIMETHOXYBENZOYL CHLORIDE Preparation Products And Raw materials |
|