|
|
| | Diethylamine salicylate Basic information |
| Product Name: | Diethylamine salicylate | | Synonyms: | diethylammoniumsalicylate;Salicylic acid·diethylamine;DiethylaMine Salicylate BP;Diethylamine 2-hydroxybenzoate;Diethylammoniumsalicylat;DIETHYLAMINE SALICYLATE USP/EP/BP;Morpholine,4-(4-bromopropyl)-;Algesal | | CAS: | 4419-92-5 | | MF: | C11H17NO3 | | MW: | 211.26 | | EINECS: | 224-586-4 | | Product Categories: | Heterocyclic Compounds | | Mol File: | 4419-92-5.mol |  |
| | Diethylamine salicylate Chemical Properties |
| Melting point | >75oC (melt) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Acetonitrile (Slightly), Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Brown | | InChI | InChI=1S/C7H6O3.C4H11N/c8-6-4-2-1-3-5(6)7(9)10;1-3-5-4-2/h1-4,8H,(H,9,10);5H,3-4H2,1-2H3 | | InChIKey | JGMKRAUEFASZKH-UHFFFAOYSA-N | | SMILES | C1(C(=O)O)C=CC=CC=1O.N(CC)CC |
| | Diethylamine salicylate Usage And Synthesis |
| Chemical Properties | white crystalline | | Uses | Counter-irritant. | | Uses | Diethylamine Salicylate; The Diethylamine Salicylate cream is used in the relief of rheumatic pains. |
| | Diethylamine salicylate Preparation Products And Raw materials |
|