|  | |  |  | DIETHYLAMINE SALICYLATE Basic information | 
 | Product Name: | DIETHYLAMINE SALICYLATE |  | Synonyms: | DIETHYLAMINE SALICYLATE;diethylammoniumsalicylate;Salicylic acid·diethylamine;DiethylaMine Salicylate BP;Diethylamine 2-hydroxybenzoate;Diethylammoniumsalicylat;DIETHYLAMINE SALICYLATE USP/EP/BP;Morpholine,4-(4-bromopropyl)- |  | CAS: | 4419-92-5 |  | MF: | C11H17NO3 |  | MW: | 211.26 |  | EINECS: | 224-586-4 |  | Product Categories: | Heterocyclic Compounds |  | Mol File: | 4419-92-5.mol |  |  | 
|  |  | DIETHYLAMINE SALICYLATE Chemical Properties | 
 | Melting point | >75oC (melt) |  | storage temp. | Sealed in dry,Room Temperature |  | solubility | Acetonitrile (Slightly), Chloroform (Slightly), Methanol (Slightly) |  | form | Solid |  | color | White to Brown |  | InChI | InChI=1S/C7H6O3.C4H11N/c8-6-4-2-1-3-5(6)7(9)10;1-3-5-4-2/h1-4,8H,(H,9,10);5H,3-4H2,1-2H3 |  | InChIKey | JGMKRAUEFASZKH-UHFFFAOYSA-N |  | SMILES | C1(C(=O)O)C=CC=CC=1O.N(CC)CC | 
|  |  | DIETHYLAMINE SALICYLATE Usage And Synthesis | 
 | Chemical Properties | white crystalline |  | Uses | Counter-irritant. |  | Uses | Diethylamine Salicylate; The Diethylamine Salicylate cream is used in the relief of rheumatic pains. | 
|  |  | DIETHYLAMINE SALICYLATE Preparation Products And Raw materials | 
                 |