|
|
| | Carbamic acid, (5-amino-2-pyridinyl)-, 1,1-dimethylethyl ester (9CI) Basic information |
| Product Name: | Carbamic acid, (5-amino-2-pyridinyl)-, 1,1-dimethylethyl ester (9CI) | | Synonyms: | Carbamic acid, (5-amino-2-pyridinyl)-, 1,1-dimethylethyl ester (9CI);tert-butyl 5-aminopyridin-2-ylcarbamate;Carbamic acid, (5-amino-2-pyridinyl)-, 1,1-dimethylethyl ester;tert-Butyl (5-aminopyridin-2-yl);tert-Butyl N-(5-aminopyridin-2-yl)carbamate;Carbamic acid, N-(5-amino-2-pyridinyl)-, 1,1-dimethylethyl ester;ert-butylN-(5-aminopyridin-2-yl)carbamate;N2-Boc-pyridine-2,5-diamine | | CAS: | 220731-04-4 | | MF: | C10H15N3O2 | | MW: | 209.24 | | EINECS: | | | Product Categories: | N-BOC | | Mol File: | 220731-04-4.mol |  |
| | Carbamic acid, (5-amino-2-pyridinyl)-, 1,1-dimethylethyl ester (9CI) Chemical Properties |
| Boiling point | 330.2±27.0 °C(Predicted) | | density | 1.202±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 12.19±0.70(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C10H15N3O2/c1-10(2,3)15-9(14)13-8-5-4-7(11)6-12-8/h4-6H,11H2,1-3H3,(H,12,13,14) | | InChIKey | NHVPESPHUUFULF-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NC1=NC=C(N)C=C1 |
| Risk Statements | 43 | | Safety Statements | 36/37 |
| | Carbamic acid, (5-amino-2-pyridinyl)-, 1,1-dimethylethyl ester (9CI) Usage And Synthesis |
| Synthesis | General procedure for the synthesis of tert-butyl (5-aminopyridin-2-yl)carbamate from tert-butyl (5-nitropyridin-2-yl)carbamate: tert-butyl (5-nitropyridin-2-yl)carbamate (1 eq.), 10% palladium carbon by weight of the raw material and ethyl acetate were added to a reaction flask under hydrogen atmosphere. The reaction mixture was stirred and reacted at room temperature overnight. Upon completion of the reaction, the mixture was filtered through a diatomaceous earth pad and the filtrate was concentrated under reduced pressure to give the target product tert-butyl (5-aminopyridin-2-yl)carbamate. The product was analyzed by HPLC-MS (Method A): retention time Rt = 1.50 min, molecular ion peak [M + H]+ m/z: 210. The reaction yield was quantitative. | | References | [1] Patent: WO2016/120808, 2016, A1. Location in patent: Page/Page column 104
[2] Patent: US2010/249099, 2010, A1. Location in patent: Page/Page column 96
[3] Patent: US2011/9405, 2011, A1. Location in patent: Page/Page column 54
[4] Patent: EP2518071, 2012, A1. Location in patent: Page/Page column 41-42
[5] Patent: WO2012/146667, 2012, A1. Location in patent: Page/Page column 95-96 |
| | Carbamic acid, (5-amino-2-pyridinyl)-, 1,1-dimethylethyl ester (9CI) Preparation Products And Raw materials |
|