|
|
| | Alanine, N-(1-carboxyethyl)- (9CI) Basic information |
| | Alanine, N-(1-carboxyethyl)- (9CI) Chemical Properties |
| Melting point | 247 °C(Solv: ethanol (64-17-5)) | | Boiling point | 341℃ | | density | 1.275 | | Fp | 160℃ | | pka | 1.85±0.10(Predicted) | | InChI | InChI=1S/C6H11NO4/c1-3(5(8)9)7-4(2)6(10)11/h3-4,7H,1-2H3,(H,8,9)(H,10,11)/t3-,4/m0/s1 | | InChIKey | FIOHTMQGSFVHEZ-WUCPZUCCSA-N | | SMILES | C(O)(=O)[C@H](C)NC(C(O)=O)C |
| | Alanine, N-(1-carboxyethyl)- (9CI) Usage And Synthesis |
| Definition | ChEBI: 2,2'-iminodipropanoic acid is an amino dicarboxylic acid that is 2,2'-iminodiacetic acid substituted by methyl groups at positions 2 and 2'. It is an amino dicarboxylic acid and an amino acid opine. It is functionally related to a propionic acid. It is a conjugate acid of a 2,2'-iminodipropanoate and a 2,2'-iminodipropanoate(1-). |
| | Alanine, N-(1-carboxyethyl)- (9CI) Preparation Products And Raw materials |
|