|
|
| | 3,6-Dimethoxyxanthone Basic information |
| | 3,6-Dimethoxyxanthone Chemical Properties |
| Melting point | 350°C (rough estimate) | | Boiling point | 330°C (rough estimate) | | density | 1.3036 (rough estimate) | | refractive index | 1.4977 (estimate) | | storage temp. | 4°C, stored under nitrogen | | form | Solid | | pka | 7.18±0.20(Predicted) | | color | White to yellow | | InChI | InChI=1S/C13H8O4/c14-7-1-3-9-11(5-7)17-12-6-8(15)2-4-10(12)13(9)16/h1-6,14-15H | | InChIKey | POARTHFLPKAZBQ-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=C(O)C=C2)OC2=C1C=CC(O)=C2 |
| | 3,6-Dimethoxyxanthone Usage And Synthesis |
| Uses | 3,6-Dihydroxy-xanthen-9-one is used in preparation method of Heterocyclic compounds and application in the preparation of Lanreotide. | | Synthesis | The raw material 2,2',4,4'-tetrahydroxybenzophenone (5.0 g, 0.02 mol) was mixed with water (65 mL) in a mulled tank and reacted at 220 degrees Celsius for 6 hours, cooled down and filtered to obtain a solid, and then the solid was spun-dried under vacuum to obtain the yellowish solid compound 3,6-dihydroxy-xanthen-9-one. |
| | 3,6-Dimethoxyxanthone Preparation Products And Raw materials |
| Raw materials | Phosphoric acid, diethyl (6-hydroxy-3-oxo-3H-xanthen-9-yl)methyl ester, compd. with 4,5-dichloro-3,6-dioxo-1,4-cyclohexadiene-1,2-dicarbonitrile (1:1)-->2,2',4,4'-Tetrahydroxybenzophenone-->3,6-dimethoxy-9H-xanthen-9-one-->3,6-BIS[[(1,1-DIMETHYLETHYL)DIMETHYLSILYL]OXY]-9H-XANTHEN-9-ONE-->2,4-Dihydroxybenzaldehyde-->4-Fluorophenylacetylene-->2,4-Dihydroxybenzoic acid-->Resorcinol | | Preparation Products | 9H-Xanthen-9-one, 3,6-dichloro--->Methanesulfonic acid, 1,1,1-trifluoro-, 1,1'-(9-oxo-9H-xanthene-3,6-diyl) ester |
|