2,5-Dichlorothiophene-3-sulfonyl chloride manufacturers
|
| | 2,5-Dichlorothiophene-3-sulfonyl chloride Basic information |
| | 2,5-Dichlorothiophene-3-sulfonyl chloride Chemical Properties |
| Melting point | 130 °C | | Boiling point | 256-257 °C (lit.) | | density | 1.697 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.595(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | Sensitive | Moisture Sensitive | | BRN | 1285315 | | InChI | 1S/C4HCl3O2S2/c5-3-1-2(4(6)10-3)11(7,8)9/h1H | | InChIKey | JJKSHSHZJOWSEC-UHFFFAOYSA-N | | SMILES | Clc1cc(c(Cl)s1)S(Cl)(=O)=O | | CAS DataBase Reference | 56946-83-9(CAS DataBase Reference) |
| Hazard Codes | C,Xi | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 1760 8/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29349990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| | 2,5-Dichlorothiophene-3-sulfonyl chloride Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | 2,5-Dichlorothiophene-3-sulfonyl chloride may be used in the preparation of:
- 1-[(2,5-dichloro-3-thienyl)sulfonyl]-N-(6-nitro-1,3-benzothiazol-2-yl)piperidine-4-carboxamide
- 6-chloro-3-isopropylamino-4H-thieno[2,3-e]-1,2,4-thiadiazine 1,1-dioxide
- 6-fluoro-3-methyl-4-(2,5-dichlorothiophene-3-sulfonyl)-3,4-dihydroquinoxalin-2-(1H)-one
| | General Description | 2,5-Dichlorothiophene-3-sulfonyl chloride is an heteroaryl sulfonyl chloride derivative. |
| | 2,5-Dichlorothiophene-3-sulfonyl chloride Preparation Products And Raw materials |
|