| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:3-NoradaMantanecarbonyl chloride
CAS:67064-09-9
Purity:97% Package:1G
|
| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:3-Noradamantanecarbonyl chloride
CAS:67064-09-9
Purity:98% Remarks:B35159
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:3-Noradamantanecarbonyl chloride
CAS:67064-09-9
Purity:97% Package:1G Remarks:678678-1G
|
2,5-Methanopentalene-3a(1H)-carbonyl chloride, hexahydro- (9CI) manufacturers
|
| | 2,5-Methanopentalene-3a(1H)-carbonyl chloride, hexahydro- (9CI) Basic information |
| Product Name: | 2,5-Methanopentalene-3a(1H)-carbonyl chloride, hexahydro- (9CI) | | Synonyms: | 2,5-Methanopentalene-3a(1H)-carbonyl chloride, hexahydro- (9CI);3-NORADAMANTANECARBONYL CHLORIDE;3-Noradamantanoyl chloride, Hexahydro-2,5-methanopentalene-3a(1H)-carbonyl chloride;3-Noradamantanoyl chloride;Hexahydro-2,5-methanopentalene-3a(1H)-carbonyl chloride;Noradamantane-3-carbonyl chloride;2,5-Methanopentalene-3a(1H)-carbonyl chloride, hexahydro-;2,5-Methanopentalene-3a(1H)-carbonyl chloride, hexahydro- (9CI) ISO 9001：2015 REACH | | CAS: | 67064-09-9 | | MF: | C10H13ClO | | MW: | 184.66 | | EINECS: | | | Product Categories: | ACIDHALIDE;Acid Halides;Building Blocks;Carbonyl Compounds;Chemical Synthesis;Organic Building Blocks | | Mol File: | 67064-09-9.mol |  |
| | 2,5-Methanopentalene-3a(1H)-carbonyl chloride, hexahydro- (9CI) Chemical Properties |
| Boiling point | 235.6±9.0 °C(Predicted) | | density | 1.165 g/mL at 25 °C | | refractive index | n20/D 1.5159 | | Fp | 109 °C | | form | Solid | | color | White to off-white | | Sensitive | Moisture Sensitive | | InChI | 1S/C10H13ClO/c11-9(12)10-4-6-1-7(5-10)3-8(10)2-6/h6-8H,1-5H2/t6-,7+,8-,10- | | InChIKey | FEJBSNLESASJKD-WZXRXUJPSA-N | | SMILES | ClC(=O)C12C[C@H]3C[C@H](C[C@H]1C3)C2 |
| Hazard Codes | C,Xn | | Risk Statements | 22-34-52/53 | | Safety Statements | 26-36/37/39-45-61 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | HazardClass | 8 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 3
Eye Irrit. 2
Skin Corr. 1B |
| | 2,5-Methanopentalene-3a(1H)-carbonyl chloride, hexahydro- (9CI) Usage And Synthesis |
| | 2,5-Methanopentalene-3a(1H)-carbonyl chloride, hexahydro- (9CI) Preparation Products And Raw materials |
|