1,3-Bis(4-bromophenyl)propanone manufacturers
|
| | 1,3-Bis(4-bromophenyl)propanone Basic information |
| Product Name: | 1,3-Bis(4-bromophenyl)propanone | | Synonyms: | 1,3-bis(4-bromophenyl)propanone;4,4'-Dibromodibenzyl ketone;1,3-Bis(4-bromophenyl)-2-propanone;1,3-Bis(4-bromophenyl)acetone;1,3-Bis(4-bromopheny;1,3-. Molecular ForMula;1,3-Bis(4-broMophenyl)propan-1-one;1,3-Bis(4-broMophenyl)propan- | | CAS: | 54523-47-6 | | MF: | C15H12Br2O | | MW: | 368.06 | | EINECS: | | | Product Categories: | Naphthyridine,Quinoline | | Mol File: | 54523-47-6.mol |  |
| | 1,3-Bis(4-bromophenyl)propanone Chemical Properties |
| Melting point | 117.0 to 121.0 °C | | Boiling point | 427 °C | | density | 1.607 | | Fp | 114 °C | | storage temp. | Store at room temperature | | form | powder to crystal | | color | White to Light yellow | | InChI | InChI=1S/C15H12Br2O/c16-13-5-1-11(2-6-13)9-15(18)10-12-3-7-14(17)8-4-12/h1-8H,9-10H2 | | InChIKey | DQQKEYDDVSREIE-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(Br)C=C1)C(=O)CC1=CC=C(Br)C=C1 |
| | 1,3-Bis(4-bromophenyl)propanone Usage And Synthesis |
| Chemical Properties | off-white powder |
| | 1,3-Bis(4-bromophenyl)propanone Preparation Products And Raw materials |
|