|
|
| | Methyl 4-hydroxy-2-methylbenzoate Basic information |
| Product Name: | Methyl 4-hydroxy-2-methylbenzoate | | Synonyms: | Methyl 4-hydroxy-2-methylbenzoate;4-Hydroxy-2-methylbenzoic acid methyl ester;Methyl 2-methyl-4-hydroxybenzoate;Hemihydrate of 4-hydroxy-3-chlorobenzoic acid;Benzoic acid, 4-hydroxy-2-methyl-, methyl ester | | CAS: | 57556-31-7 | | MF: | C9H10O3 | | MW: | 166.17 | | EINECS: | | | Product Categories: | Aromatic Esters | | Mol File: | Mol File |  |
| | Methyl 4-hydroxy-2-methylbenzoate Chemical Properties |
| Melting point | 106-110℃ | | Boiling point | 275℃ | | density | 1.169 | | Fp | 117℃ | | storage temp. | Sealed in dry,Room Temperature | | pka | 8.47±0.18(Predicted) | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/C9H10O3/c1-6-5-7(10)3-4-8(6)9(11)12-2/h3-5,10H,1-2H3 | | InChIKey | FINKSGWSBJRISB-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=C(O)C=C1C |
| | Methyl 4-hydroxy-2-methylbenzoate Usage And Synthesis |
| | Methyl 4-hydroxy-2-methylbenzoate Preparation Products And Raw materials |
|