|
|
| | 5-Amino-3-bromo-2-methoxypyridine Basic information |
| | 5-Amino-3-bromo-2-methoxypyridine Chemical Properties |
| Boiling point | 292.4±35.0 °C(Predicted) | | density | 1.622±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 2.10±0.10(Predicted) | | Appearance | Light brown to brown Solid | | InChI | InChI=1S/C6H7BrN2O/c1-10-6-5(7)2-4(8)3-9-6/h2-3H,8H2,1H3 | | InChIKey | YWYVVGOHQBANQI-UHFFFAOYSA-N | | SMILES | C1=NC(OC)=C(Br)C=C1N | | CAS DataBase Reference | 53242-18-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 43 | | Safety Statements | 36/37 | | HazardClass | IRRITANT | | HS Code | 2933399990 |
| | 5-Amino-3-bromo-2-methoxypyridine Usage And Synthesis |
| Uses | 5-Amino-3-bromo-2-methoxypyridine is a bromine-substituted methoxypyridine compound. The substitution of halogen and amino groups increases its reactivity. It is a versatile chemical compound with significant applications in pharmaceutical research and development.
|
| | 5-Amino-3-bromo-2-methoxypyridine Preparation Products And Raw materials |
|