|
|
| | 4-Aminocatechol Basic information |
| | 4-Aminocatechol Chemical Properties |
| Melting point | 124-125 °C | | Boiling point | 351.9±27.0 °C(Predicted) | | density | 1.412±0.06 g/cm3(Predicted) | | solubility | DMSO (Sparingly), Methanol (Slightly) | | form | Solid | | pka | 9.85±0.10(Predicted) | | color | Dark Brown to Black | | Stability: | Hygroscopic | | InChI | InChI=1S/C6H7NO2/c7-4-1-2-5(8)6(9)3-4/h1-3,8-9H,7H2 | | InChIKey | KDHUXRBROABJBC-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(N)C=C1O |
| | 4-Aminocatechol Usage And Synthesis |
| Uses | A phenol derivative with inhibitory activity against matrix metalloproteinase (MMP). | | Definition | ChEBI: 4-Aminocatechol is a member of catechols. |
| | 4-Aminocatechol Preparation Products And Raw materials |
|