|
|
| | 3-(4-Methylpiperazin-1-ylmethyl)benzoic acid Basic information |
| Product Name: | 3-(4-Methylpiperazin-1-ylmethyl)benzoic acid | | Synonyms: | 3-(4-METHYL-PIPERAZIN-1-YLMETHYL)-BENZOIC ACID;AKOS BB-9414;3-(4-Methyl-piperazin-1-ylmethyl)-benzoic acid ,98%;3-(4-Methylpiperazin-1-ylmethyl)benzoicacid95%;3-(4-METHYLPIPERAZIN-1-YLMETHYL)BENZOIC ACID 95%;3-[(4-methyl-1-piperazinyl)methyl]benzoic acid;Benzoic acid, 3-[(4-methyl-1-piperazinyl)methyl]- | | CAS: | 514209-42-8 | | MF: | C13H18N2O2 | | MW: | 234.29 | | EINECS: | 604-604-1 | | Product Categories: | API intermediates | | Mol File: | 514209-42-8.mol |  |
| | 3-(4-Methylpiperazin-1-ylmethyl)benzoic acid Chemical Properties |
| Boiling point | 383.7±32.0 °C(Predicted) | | density | 1.174±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | form | solid | | pka | 4.28±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | 1S/C13H18N2O2/c1-14-5-7-15(8-6-14)10-11-3-2-4-12(9-11)13(16)17/h2-4,9H,5-8,10H2,1H3,(H,16,17) | | InChIKey | SMSCFZLMSBEZQU-UHFFFAOYSA-N | | SMILES | O=C(O)C1=CC=CC(CN2CCN(C)CC2)=C1 |
| Hazard Codes | Xi | | Risk Statements | 36-34-22 | | Safety Statements | 26-45-36/37/39-23 | | WGK Germany | 3 | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| | 3-(4-Methylpiperazin-1-ylmethyl)benzoic acid Usage And Synthesis |
| Chemical Properties | White solid | | Uses | 3-(4-Methylpiperazin-1-ylmethyl)benzoic Acid is a reagent used in the preparation of highly potent M3 muscarinic acetylcholine receptors. |
| | 3-(4-Methylpiperazin-1-ylmethyl)benzoic acid Preparation Products And Raw materials |
|