2,3,4-Trimethoxy-6-methylphenol manufacturers
|
| | 2,3,4-Trimethoxy-6-methylphenol Basic information |
| Product Name: | 2,3,4-Trimethoxy-6-methylphenol | | Synonyms: | 2,3,4-TRIMETHOXY-6-METHYLPHENOL;2,3,4-trimethoxy-6-methyylphenol;2,3,4-Trimethoxy-6-Methylpheno;2-Hydroxy-3,4,5-trimethoxytoluene;6-Methyl-2,3,4-trimethoxyphenol;4-TriMethoxy-6-Methylphenol;Phenol, 2,3,4-trimethoxy-6-methyl- | | CAS: | 39068-88-7 | | MF: | C10H14O4 | | MW: | 198.22 | | EINECS: | | | Product Categories: | Aromatic Phenols;Phenol&Thiophenol&Mercaptan;Phenoles and thiophenoles | | Mol File: | 39068-88-7.mol |  |
| | 2,3,4-Trimethoxy-6-methylphenol Chemical Properties |
| Boiling point | 33-34°C | | density | 1.125±0.06 g/cm3(Predicted) | | storage temp. | RT, stored under nitrogen | | pka | 10.45±0.28(Predicted) | | Appearance | Yellow to brown Solid | | InChI | InChI=1S/C10H14O4/c1-6-5-7(12-2)9(13-3)10(14-4)8(6)11/h5,11H,1-4H3 | | InChIKey | UGNJWQMNCJYWHG-UHFFFAOYSA-N | | SMILES | C1(O)=C(C)C=C(OC)C(OC)=C1OC | | CAS DataBase Reference | 39068-88-7(CAS DataBase Reference) |
| | 2,3,4-Trimethoxy-6-methylphenol Usage And Synthesis |
| Uses | 2,3,4-Trimethoxy-6-methylphenol acts as a reagent in the synthesis of (±)-antroquinonol D with potential anticancer properties. |
| | 2,3,4-Trimethoxy-6-methylphenol Preparation Products And Raw materials |
|