|
|
| | N,N'-Bis(2-hydroxyethyl)oxamide Basic information |
| Product Name: | N,N'-Bis(2-hydroxyethyl)oxamide | | Synonyms: | S-DIETHANOLOXAMIDE;TIMTEC-BB SBB008397;N,N'-OXALYLBIS(ETHANOLAMINE);N,N'-DIETHANOLOXAMIDE;Ethanediamide, N,N'-bis(2-hydroxyethyl)-;n,n’-bis(2-hydroxyethyl)-ethanediamid;N1,N2-Bis(2-hydroxyethyl)oxalaMide;N,N'-bis(2-hydroxyethyl)ethanediamide | | CAS: | 1871-89-2 | | MF: | C6H12N2O4 | | MW: | 176.17 | | EINECS: | | | Product Categories: | Amides;Carbonyl Compounds;Organic Building Blocks;Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts | | Mol File: | 1871-89-2.mol |  |
| | N,N'-Bis(2-hydroxyethyl)oxamide Chemical Properties |
| Melting point | 168 °C (dec.)(lit.) | | density | 1.310±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | form | powder to crystal | | pka | 11.69±0.46(Predicted) | | color | White to Almost white | | Water Solubility | Insoluble in water. | | Sensitive | Hygroscopic | | InChI | InChI=1S/C6H12N2O4/c9-3-1-7-5(11)6(12)8-2-4-10/h9-10H,1-4H2,(H,7,11)(H,8,12) | | InChIKey | FPQJEXTVQZHURJ-UHFFFAOYSA-N | | SMILES | C(NCCO)(=O)C(NCCO)=O | | CAS DataBase Reference | 1871-89-2(CAS DataBase Reference) | | NIST Chemistry Reference | Oxamide, n,n'-bis-(2-hydroxyethyl)-(1871-89-2) | | EPA Substance Registry System | Ethanediamide, N1,N2-bis(2-hydroxyethyl)- (1871-89-2) |
| Hazard Codes | T,Xi | | Risk Statements | 43 | | Safety Statements | 45-36/37 | | RIDADR | UN 1759 8/PG 2 | | WGK Germany | 3 | | TSCA | Yes | | HS Code | 2924.19.8000 | | HazardClass | 8 | | PackingGroup | III |
| | N,N'-Bis(2-hydroxyethyl)oxamide Usage And Synthesis |
| Uses | N.N'-Bis(2-hydroxyethyl)oxamide is an important raw material and intermediate used in organic Synthesis, pharmaceuticals, agrochemicals and dyestuff. |
| | N,N'-Bis(2-hydroxyethyl)oxamide Preparation Products And Raw materials |
|