|
|
| | O-Desmorpholinopropyl Gefitinib Basic information |
| | O-Desmorpholinopropyl Gefitinib Chemical Properties |
| Melting point | >260°C (dec.) | | Boiling point | 478.8±45.0 °C(Predicted) | | density | 1.489±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | solubility | DMSO (Slightly), Methanol (Very Slightly, Heated) | | form | Solid | | pka | 8.18±0.40(Predicted) | | color | Pale Beige to Beige | | InChI | InChI=1S/C15H11ClFN3O2/c1-22-14-6-12-9(5-13(14)21)15(19-7-18-12)20-8-2-3-11(17)10(16)4-8/h2-7,21H,1H3,(H,18,19,20) | | InChIKey | JLVTVCRXFMLUIF-UHFFFAOYSA-N | | SMILES | N1=C2C(C=C(O)C(OC)=C2)=C(NC2=CC=C(F)C(Cl)=C2)N=C1 |
| | O-Desmorpholinopropyl Gefitinib Usage And Synthesis |
| Description |
O-Desmorpholinopropyl Gefitinib is a metabolite of Gefitinib, a potent inhibitor of tyrosine phosporylation in EGFR. The chemical structure of O-Desmorpholinopropyl Gefitinib consists of a quinazoline-6-ol core with a phenylamino group attached to a chloro-fluoro-phenyl ring, enabling it to interact with multiple biological targets. It is involved in inhibiting enzymes such as cyclooxygenase-2 (COX-2) and inducible nitric oxide synthase (iNOS).
| | Chemical Properties | Tan Solid | | Uses | A metabolite of Gefitinib. | | Definition | ChEBI: O-Desmorpholinopropyl Gefitinib is a member of quinazolines. |
| | O-Desmorpholinopropyl Gefitinib Preparation Products And Raw materials |
|