Sanshool manufacturers
- Sanshool
-
- $15.00 / 1KG
-
2021-07-13
- CAS:504-97-2
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
- Sanshool
-
- $15.00 / 1KG
-
2021-07-10
- CAS:504-97-2
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | Sanshool Basic information | | Uses |
| Product Name: | Sanshool | | Synonyms: | Sanshool;sanshoaMides;(2E,6Z,8E,10E)-N-(2-Methylpropyl)dodeca-2,6,8,10-tetraenaMide;alpha-Sanshooel;Neoherculine;N-Isobutyl-trans-2,cis-6,trans-8,trans-10-dodecatetraenamide;(2E,6Z,8E,10E)-N-(2-Methylpropyl)-2,6,8,10-dodecatetraenamide;2,6,8,10-Dodecatetraenamide, N-(2-methylpropyl)-, (2E,6Z,8E,10E)- | | CAS: | 504-97-2 | | MF: | C16H25NO | | MW: | 247.38 | | EINECS: | | | Product Categories: | | | Mol File: | 504-97-2.mol |  |
| | Sanshool Chemical Properties |
| Melting point | 63-65 °C | | Boiling point | 423.5±38.0 °C(Predicted) | | density | 0.904±0.06 g/cm3(Predicted) | | pka | 15.06±0.46(Predicted) | | InChI | InChI=1S/C16H25NO/c1-4-5-6-7-8-9-10-11-12-13-16(18)17-14-15(2)3/h4-9,12-13,15H,10-11,14H2,1-3H3,(H,17,18)/b5-4+,7-6+,9-8-,13-12+ | | InChIKey | SBXYHCVXUCYYJT-UEOYEZOQSA-N | | SMILES | C(NCC(C)C)(=O)/C=C/CC/C=C\C=C\C=C\C |
| | Sanshool Usage And Synthesis |
| Uses | Sanshool has various physiological functions, such as anesthesia, stimulation, antibacterial, wind-dispelling and dampness-removing, insecticidal, and analgesic effects. It will be increasingly widely used in food, medicine, and cosmetics. | | Definition | ChEBI: Alpha-Sanshool is a fatty amide. |
| | Sanshool Preparation Products And Raw materials |
|