|
|
| | Benzenepropanamine, 4-methoxy-N-[(1S)-1-methyl-2-phenylethyl]- Basic information |
| | Benzenepropanamine, 4-methoxy-N-[(1S)-1-methyl-2-phenylethyl]- Chemical Properties |
| Boiling point | 417.2±33.0 °C(Predicted) | | density | 1.004±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | oil | | pka | 10.29±0.28(Predicted) | | color | colorless to brown | | InChIKey | LKTLDVZCNLGHOG-INIZCTEOSA-N | | SMILES | N([C@H](Cc2ccccc2)C)CCCc1ccc(cc1)OC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Benzenepropanamine, 4-methoxy-N-[(1S)-1-methyl-2-phenylethyl]- Usage And Synthesis |
| Uses | GZ-11608 is a potent and selective vesicular monoamine transporter-2 (VMAT2) inhibitor with high affinity (Ki = 25 nM). GZ-11608 decreases methamphetamine-induced dopamine release from isolated synaptic vesicles from brain dopaminergic neurons. GZ-11608 exhibits rapid brain penetration and without neurotoxicity. GZ-11608 can be used for the research of methamphetamine use disorder[1]. | | Biological Activity | GZ-11608 is a potent and selective inhibitor of vesicular monoamine transporter-2 (VMAT2) th at diminished hERG interaction. GZ-11608 reduces behavioral effects of methamphetamine such as locomotor activity, self-administration, and methamphetamine seeking behavior. It does not exhibit abuse liability. GZ-11608 inhibits methamphetamine-induced dopamine release from isolated synaptic vesicles from brain dopaminergic neurons. | | References | [1] Lee NR, et al. GZ-11608, a Vesicular Monoamine Transporter-2 Inhibitor, Decreases the Neurochemical and Behavioral Effects of Methamphetamine. J Pharmacol Exp Ther. 2019 Nov;371(2):526-543. DOI:10.1124/jpet.119.258699 |
| | Benzenepropanamine, 4-methoxy-N-[(1S)-1-methyl-2-phenylethyl]- Preparation Products And Raw materials |
|