- BOC-MET(O)-OH
-
- $1.00 / 1KG
-
2019-07-06
- CAS:34805-21-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
- BOC-MET(O)-OH
-
- $7.00 / 1KG
-
2019-07-06
- CAS:34805-21-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 1000KG
|
| | BOC-MET(O)-OH Basic information |
| | BOC-MET(O)-OH Chemical Properties |
| Melting point | 120-130° | | Boiling point | 509.3±45.0 °C(Predicted) | | density | 1.260±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Solid | | pka | 3.70±0.10(Predicted) | | Major Application | peptide synthesis | | InChI | 1S/C10H19NO5S/c1-10(2,3)16-9(14)11-7(8(12)13)5-6-17(4)15/h7H,5-6H2,1-4H3,(H,11,14)(H,12,13)/t7-,17/m0/s1 | | InChIKey | FVSDTYGQCVACMH-ISJKBYAMSA-N | | SMILES | [S](=O)(CC[C@H](NC(=O)OC(C)(C)C)C(=O)O)C | | CAS DataBase Reference | 34805-21-5(CAS DataBase Reference) |
| WGK Germany | WGK 2 water endangering | | HS Code | 2930 90 98 | | Storage Class | 11 - Combustible Solids |
| | BOC-MET(O)-OH Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis | | Synthesis | The general procedure for synthesizing the compound (CAS:2488-17-7) from Boc-L-methionine was as follows: general method: 38% hydrogen peroxide solution (0.094 mL, 1.2 mmol) was slowly added to a solution of Boc-L-methionine or acetic acid (7 mL) of methionine-containing peptide. The reaction mixture was kept at a constant temperature of 20°C for 30 min. Subsequently, 5% Pd/C catalyst (0.2 g) was added and the reaction mixture continued to be stirred for 30 min. After completion of the reaction, the activated carbon was removed by filtration and the filtrate was concentrated under vacuum. In case of Boc-L-methionine, the concentrated residue was dissolved in toluene, concentrated again under vacuum and the product was placed in a vacuum desiccator and dried using P4O10 as desiccant. In case of peptide containing methionine, the residue was dissolved in water and lyophilized. | | References | [1] Tetrahedron, 2012, vol. 68, # 35, p. 7070 - 7076 |
| | BOC-MET(O)-OH Preparation Products And Raw materials |
|