|
|
| | Butanoic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-4,4-difluoro-, methyl ester Basic information |
| Product Name: | Butanoic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-4,4-difluoro-, methyl ester | | Synonyms: | Butanoic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-4,4-difluoro-, methyl ester;2-tert-Butoxycarbonylamino-4,4-difluoro-butyric acid;Methyl 2-((tert-butoxycarbonyl)amino)-4,4-difluorobutanoate | | CAS: | 1662681-19-7 | | MF: | C10H17F2NO4 | | MW: | 253.24 | | EINECS: | | | Product Categories: | | | Mol File: | 1662681-19-7.mol | ![Butanoic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-4,4-difluoro-, methyl ester Structure](CAS/20210305/GIF/1662681-19-7.gif) |
| | Butanoic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-4,4-difluoro-, methyl ester Chemical Properties |
| Boiling point | 300.4±42.0 °C(Predicted) | | density | 1.145±0.06 g/cm3(Predicted) | | pka | 10+-.0.46(Predicted) | | InChI | InChI=1S/C10H17F2NO4/c1-10(2,3)17-9(15)13-6(5-7(11)12)8(14)16-4/h6-7H,5H2,1-4H3,(H,13,15) | | InChIKey | SRJNSQAUCPDXSN-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C(NC(OC(C)(C)C)=O)CC(F)F |
| | Butanoic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-4,4-difluoro-, methyl ester Usage And Synthesis |
| | Butanoic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-4,4-difluoro-, methyl ester Preparation Products And Raw materials |
|