|
(4R)-4-[(3S,5S,8R,9S,10S,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid Suppliers list
|
| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
| Company Name: |
Rhawn Reagent |
| Tel: |
400-400-1332688 18019345275 |
| Email: |
huyue@rhawn.cn |
(4R)-4-[(3S,5S,8R,9S,10S,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid manufacturers
|
| | (4R)-4-[(3S,5S,8R,9S,10S,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid Basic information |
| Product Name: | (4R)-4-[(3S,5S,8R,9S,10S,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid | | Synonyms: | 5a-Cholanic Acid-3-ol-d2;Isoallolithocholic Acid (5-alfa-Cholanic Acid-3-beta-ol);(R)-4-((3S,5S,8R,9S,10S,13R,14S,17R)-3-hydroxy-10,13-dimethylhexadecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoic acid;5a-CHOLANIC ACID-3-β-OL;5α-Cholanic Acid-3β-ol D2;EPIALLOLITHOCHOLIC ACID;Cholan-24-oic acid, 3-hydroxy-, (3β,5α)-;5α-CHOLANIC ACID-3β-OL | | CAS: | 2276-93-9 | | MF: | C24H40O3 | | MW: | 376.57 | | EINECS: | | | Product Categories: | | | Mol File: | 2276-93-9.mol | ![(4R)-4-[(3S,5S,8R,9S,10S,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid Structure](CAS/GIF/2276-93-9.gif) |
| | (4R)-4-[(3S,5S,8R,9S,10S,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid Chemical Properties |
| Melting point | >170°C (dec.) | | Boiling point | 511.0±23.0 °C(Predicted) | | density | 1.073±0.06 g/cm3(Predicted) | | storage temp. | -20°C, Inert atmosphere | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | pka | 4.76±0.10(Predicted) | | form | Solid | | color | White to Off-White | | InChIKey | SMEROWZSTRWXGI-XBESLWPFSA-N | | SMILES | [H][C@@]12[C@]([C@](CC[C@H](O)C3)(C)[C@@]3([H])CC2)([H])CC[C@@]4(C)[C@@]1([H])CC[C@]4([H])[C@]([H])(C)CCC(O)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | (4R)-4-[(3S,5S,8R,9S,10S,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid Usage And Synthesis |
| Uses | Isoallolithocholic Acid is used as a steroid compound as T regulatory lymphocyte modulators and uses for treatment of inflammatory or autoimmune disorders. | | Definition | ChEBI: Isoallolithocholic acid is a bile acid. | | in vivo | Isoallolithocholic acid (0.03%; in diet; 7 days) enhances Treg cells in B6 mice[1]. | Animal Model: | Segmented filamentous bacteria (SFB)-colonized Jax-B6 mice[1] | | Dosage: | 0.03% (w/w) | | Administration: | In diet, 7 days | | Result: | Was insufficient to enhance Treg percentages both at steady state and following anti-CD3 treatment alone. Significantly enhanced the Treg population in mice treated with anti-CD3 compared to control diet in combination with 0.3% (w/w) 3-oxolithocholic acid (3-oxoLCA). Reduced the number of CD45.1+ T effector cells. |
|
| | (4R)-4-[(3S,5S,8R,9S,10S,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid Preparation Products And Raw materials |
|