| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| | Linoleyl carnitine Basic information |
| | Linoleyl carnitine Chemical Properties |
| Melting point | 115-120°C (dec.) | | storage temp. | -20°C | | solubility | Chloroform (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Yellow | | Optical Rotation | [α]/D -13±2°, c = 0.1 in methanol | | Stability: | Hygroscopic, Temperature Sensitive | | Major Application | clinical testing | | InChI | 1S/C25H45NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25(29)30-23(21-24(27)28)22-26(2,3)4/h9-10,12-13,23H,5-8,11,14-22H2,1-4H3/b10-9-,13-12-/t23-/m1/s1 | | InChIKey | MJLXQSQYKZWZCB-DQFWFXSYSA-N | | SMILES | [N+](C[C@H](OC(=O)CCCCCCC\C=C/C\C=C/CCCCC)CC(=O)[O-])(C)(C)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Linoleyl carnitine Usage And Synthesis |
| Uses | Linoleyl carnitine is a carnitine ester of unsaturated fatty acid. Used in the studies of fibroblasts in long-chain 3-hydroxyacyl-CoA dehydrogenase deficiency and fatty acid oxidation disorders. | | Definition | ChEBI: An O-octadecadienoyl-L-carnitine where the acyl group specified is linoleyl. |
| | Linoleyl carnitine Preparation Products And Raw materials |
|