R-b-aminoisobutyric acid manufacturers
|
| | R-b-aminoisobutyric acid Basic information |
| Product Name: | R-b-aminoisobutyric acid | | Synonyms: | R-b-aminoisobutyric acid;(2R)-2-Methyl-β-alanine;D-3-Aminoisobutyric acid;(2R)-3-Amino-2-methylpropionic acid;(R)-2-(Aminomethyl)propanoic acid;[R,(-)]-2-Methyl-β-alanine;R-3-Aminoisobutyric acid;Propanoic acid, 3-amino-2-methyl-, (2R)- | | CAS: | 2140-95-6 | | MF: | C4H9NO2 | | MW: | 103.12 | | EINECS: | | | Product Categories: | | | Mol File: | 2140-95-6.mol |  |
| | R-b-aminoisobutyric acid Chemical Properties |
| Melting point | 194-196 °C | | Boiling point | 223.6±23.0 °C(Predicted) | | density | 1.105±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | solid | | pka | 3.69±0.16(Predicted) | | Appearance | White to yellow Solid | | Optical Rotation | [α]/D -13±2°, c = 1 in 0.5 M HCl | | BRN | 1720957 | | InChI | InChI=1S/C4H9NO2/c1-3(2-5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m1/s1 | | InChIKey | QCHPKSFMDHPSNR-GSVOUGTGSA-N | | SMILES | C(O)(=O)[C@H](C)CN |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | R-b-aminoisobutyric acid Usage And Synthesis |
| Uses | (R)-3-Amino-2-methylpropanoic Acid blood concentration increases in human body with exercise and may contribute to exercise-induced protection from metabolic diseases. It is a product of catabolism of thymine and is therefore present in low concentration in urine of patients with a deficiency of dihydropyrimidine dehydrogenase (DPD) which is vital in first step of pyrimidine degradation. | | Definition | ChEBI: (R)-3-aminoisobutyric acid is the (R)-enantiomer of 3-aminoisobutyric acid. It is a conjugate acid of a (R)-3-aminoisobutyrate. It is an enantiomer of a (S)-3-aminoisobutyric acid. It is a tautomer of a (R)-3-aminoisobutyric acid zwitterion. |
| | R-b-aminoisobutyric acid Preparation Products And Raw materials |
|